59-30-3
Chemical Structure
Folic acid
Synonym(s): Vitamin B9; Vitamin M
- No. CAS: 59-30-3
- Formula:C19H19N7O6
- Molecular Weight:441.40
IUPAC Name: (4-(((2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)amino)benzoyl)-L-glutamic acid
InChIKey: OVBPIULPVIDEAO-LBPRGKRZSA-N
SMILES: O=C(O)CC[C@@H](C(O)=O)NC(C1=CC=C(NCC2=CN=C3N=C(N)NC(C3=N2)=O)C=C1)=O
Biological Activity: Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency[1][2][3][4].
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Folic acid | 98.55% | Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid (Standard) | 98.39% | Folic acid (Standard) is the analytical standard of Folic acid. This product is intended for research and analytical applications. Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-13C5,15N | Folic acid-15N,13C5 is the 13C5 and 15N labeled Folic acid (HY-16637). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-d4 | Folic acid-d4 is the deuterium labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-13C6 | Folic acid-13C6 is a deuterated labeled Folic acid. Folic acid (Vitamin B9) is a orally active essential nutrient from the B complex group of vitamins. Folic acid shows antidepressant-like effect. Folic acid sodium reduces the risk of neonatal neural tube defects. Folic acid can be used to the research of megaloblastic and macrocytic anemias due to folic deficiency. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-d2 | 97.86% | Folic acid-d2 (Vitamin B9-d2) is the deuterium labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Folic acid-13C5 | 95.22% | Folic acid-13C5 is the 13C-labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(Rac)-Folic acid-13C5,15N | (Rac)-Folic acid-13C5,15N is the 13C-labeled and 15N-labeled Folic acid. Folic acid (Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Butterworth CE Jr, et al. Folic acid safety and toxicity: a brief review. Am J Clin Nutr. 1989 Aug;50(2):353-8. [Content Brief]
- [2]. Brocardo PS, et al. Folic acid administration produces an antidepressant-like effect in mice: evidence for the involvement of the serotonergic and noradrenergic systems. Neuropharmacology. 2008 Feb;54(2):464-73. [Content Brief]
- [3]. Lillycrop KA, et al. Dietary protein restriction of pregnant rats induces and folic acid supplementation prevents epigenetic modification of hepatic gene expression in the offspring. J Nutr. 2005 Jun;135(6):1382-6. [Content Brief]
- [4]. Pietrzik K, et al. Folic acid and L-5-methyltetrahydrofolate: comparison of clinical pharmacokinetics and pharmacodynamics. Clin Pharmacokinet. 2010 Aug;49(8):535-48. [Content Brief]