60282-87-3
Chemical Structure
Gestodene
Synonym(s): SHB 331; WL 70
- CAS No.: 60282-87-3
- Formula:C21H26O2
- Molecular Weight:310.43
IUPAC Name: (8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,13,14,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-one
InChIKey: SIGSPDASOTUPFS-XUDSTZEESA-N
SMILES: CC[C@@]1([C@]2(O)C#C)[C@](C=C2)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@@]3([H])CC4)([H])CC1
Biological Activity: Gestodene(SHB 331;WL 70) is a progestin-based contraceptive. Gestodene is a click chemistry reagent. It contains an alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an azide group[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Gestodene | 99.89% | Gestodene(SHB 331;WL 70) is a progestin-based contraceptive. Gestodene is a click chemistry reagent. It contains an alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an azide group. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Gestodene (Standard) | ≥98% | Gestodene (Standard) is the analytical standard of Gestodene. This product is intended for research and analytical applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Gestodene-d6 | Gestodene-d6is the deuterium labeled Gestodene. Gestodene(SHB 331) is a progestogen hormonal contraceptive. Gestodene-d6 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||