60658-41-5
Chemical Structure
Myristic acid-d27
- CAS No.: 60658-41-5
- Formula:C14HD27O2
- Molecular Weight:255.54
IUPAC Name: tetradecanoic-d27 acid
InChIKey: TUNFSRHWOTWDNC-RZVOLPTOSA-N
SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(O)=O
Biological Activity: Myristic acid-d27 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Myristic acid-d27 | 98.83% | Myristic acid-d27 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid (Standard) | 99.98% | Myristic acid (Standard) is the analytical standard of Myristic acid. This product is intended for research and analytical applications. Myristic acid is an orally active saturated 14-carbon fatty acid found in most animal and plant fats, especially milk fat coconut oil, palm oil and nutmeg oil. Myristic acid exerts anti-inflammatory activity through the NF-κB pathway. Myristic acid has antibacterial, anti-inflammatory and analgesic properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-13C2 | Myristic acid-13C2 is the 13C-labeled Myristic acid (HY-N2041). Myristic acid is an orally active saturated 14-carbon fatty acid found in most animal and plant fats, especially milk fat coconut oil, palm oil and nutmeg oil. Myristic acid exerts anti-inflammatory activity through the NF-κB pathway. Myristic acid has antibacterial, anti-inflammatory and analgesic properties. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-d1 | Myristic acid-d is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-13C3 | 99.9% | Myristic acid-13C3 is the 13C labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-d3 | 98.62% | Myristic acid-d33 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-d5 | 98.0% | Myristic acid-d5 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-d2 | 98.0% | Myristic acid-d2 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-d7 | 99.50% | Myristic acid-d7 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid-13C | 99.39% | Myristic acid-13C the 13C is labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Myristic acid | 99.88% | Myristic acid is an orally active saturated 14-carbon fatty acid found in most animal and plant fats, especially milk fat coconut oil, palm oil and nutmeg oil. Myristic acid exerts anti-inflammatory activity through the NF-κB pathway. Myristic acid has antibacterial, anti-inflammatory and analgesic properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||