61-78-9
Chemical Structure
4-Aminohippuric acid
Synonym(s): p-Aminohippuric acid
- CAS No.: 61-78-9
- Formula:C9H10N2O3
- Molecular Weight:194.19
IUPAC Name: (4-aminobenzoyl)glycine
InChIKey: HSMNQINEKMPTIC-UHFFFAOYSA-N
SMILES: O=C(O)CNC(C1=CC=C(N)C=C1)=O
Biological Activity: 4-Aminohippuric acid (p-Aminohippuric acid) is a coordination ligand for metal ions (such as Cu2+, Fe3+, Hg2+) and a functionalization reagent for nanomaterials. 4-Aminohippuric acid can coordinate with metal ions or modify the surface of materials such as carbon nanotubes and gold nanoparticles through amino and carboxyl groups. 4-Aminohippuric acid can form stable complexes with metal ions or participate in the synthesis of nanomaterials as a reducing agent/stabilizer, enriching metal ions or giving nanoparticles peroxidase-mimicking activity. 4-Aminohippuric acid can be used to construct highly sensitive electrochemical sensors or colorimetric sensors to detect and quantitatively analyze heavy metal ions such as copper, iron, and mercury in environmental water samples and biological samples. 4-Aminohippuric acid may also be a biomarker for attention-deficit/hyperactivity disorder (ADHD)[1][2][3].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Aminohippuric acid | 99.84% | 4-Aminohippuric acid (p-Aminohippuric acid) is a coordination ligand for metal ions (such as Cu2+, Fe3+, Hg2+) and a functionalization reagent for nanomaterials. 4-Aminohippuric acid can coordinate with metal ions or modify the surface of materials such as carbon nanotubes and gold nanoparticles through amino and carboxyl groups. 4-Aminohippuric acid can form stable complexes with metal ions or participate in the synthesis of nanomaterials as a reducing agent/stabilizer, enriching metal ions or giving nanoparticles peroxidase-mimicking activity. 4-Aminohippuric acid can be used to construct highly sensitive electrochemical sensors or colorimetric sensors to detect and quantitatively analyze heavy metal ions such as copper, iron, and mercury in environmental water samples and biological samples. 4-Aminohippuric acid may also be a biomarker for attention-deficit/hyperactivity disorder (ADHD). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Aminohippuric acid (Standard) | 99.96% | 4-Aminohippuric acid (p-Aminohippuric acid) (Standard) is the analytical standard of 4-Aminohippuric acid (HY-B1306). This product is intended for research and analytical applications. 4-Aminohippuric acid (p-Aminohippuric acid) is a coordination ligand for metal ions (such as Cu2+, Fe3+, Hg2+) and a functionalization reagent for nanomaterials. 4-Aminohippuric acid can coordinate with metal ions or modify the surface of materials such as carbon nanotubes and gold nanoparticles through amino and carboxyl groups. 4-Aminohippuric acid can form stable complexes with metal ions or participate in the synthesis of nanomaterials as a reducing agent/stabilizer, enriching metal ions or giving nanoparticles peroxidase-mimicking activity. 4-Aminohippuric acid can be used to construct highly sensitive electrochemical sensors or colorimetric sensors to detect and quantitatively analyze heavy metal ions such as copper, iron, and mercury in environmental water samples and biological samples. 4-Aminohippuric acid may also be a biomarker for attention-deficit/hyperactivity disorder (ADHD). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Aminohippuric acid-d4 | 4-Aminohippuric acid-d4 (p-Aminohippuric acid-d4) is the deuterium labeled 4-Aminohippuric acid (HY-B1306). 4-Aminohippuric acid (p-Aminohippuric acid) is a coordination ligand for metal ions (such as Cu2+, Fe3+, Hg2+) and a functionalization reagent for nanomaterials. 4-Aminohippuric acid can coordinate with metal ions or modify the surface of materials such as carbon nanotubes and gold nanoparticles through amino and carboxyl groups. 4-Aminohippuric acid can form stable complexes with metal ions or participate in the synthesis of nanomaterials as a reducing agent/stabilizer, enriching metal ions or giving nanoparticles peroxidase-mimicking activity. 4-Aminohippuric acid can be used to construct highly sensitive electrochemical sensors or colorimetric sensors to detect and quantitatively analyze heavy metal ions such as copper, iron, and mercury in environmental water samples and biological samples. 4-Aminohippuric acid may also be a biomarker for attention-deficit/hyperactivity disorder (ADHD). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Rastogi L, et al. Intrinsic peroxidase-like activity of 4-amino hippuric acid reduced/stabilized gold nanoparticles and its application in the selective determination of mercury and iron in ground water. Spectrochim Acta A Mol Biomol Spectrosc. 2020 Mar 5;228:117805. [Content Brief]
- [2]. Mohadesi A, et al. 4-Aminohippuric acid-functionalized carbon nanotubes for stripping voltammetric determination of copper (II) ions[J]. Electrochemistry, 2016, 84(3): 138-142.
- [3]. Wang LJ, et al. Novel plasma metabolite markers of attention-deficit/hyperactivity disorder identified using high-performance chemical isotope labelling-based liquid chromatography-mass spectrometry. World J Biol Psychiatry. 2021 Feb;22(2):139-148. [Content Brief]