616-79-5
616-79-5
Chemical Structure
2-Amino-5-nitrobenzoic acid
- CAS No.: 616-79-5
- Formula:C7H6N2O4
- Molecular Weight:182.13
IUPAC Name: 2-amino-5-nitrobenzoic acid
InChIKey: RUCHWTKMOWXHLU-UHFFFAOYSA-N
SMILES: O=C(O)C1=CC([N+]([O-])=O)=CC=C1N
Biological Activity: 2-Amino-5-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-Amino-5-nitrobenzoic acid | 99.50% | 2-Amino-5-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Chloro-3-nitrobenzoic acid | 99.39% | 4-Chloro-3-nitrobenzoic acid is a benzoic acid derivative and an important intermediate for the synthesis of anticancer agents. 4-Chloro-3-nitrobenzoic acid shows low cytotoxicity against HepG2, A549 and HeLa cancer cells in vitro (>10,000 μM). 4-Chloro-3-nitrobenzoic acid can block thymidine uptake and inhibit lymphocyte growth. 4-Chloro-3-nitrobenzoic acid serves as a ligand for Cu (II) complexes and is used in the preparation of 10H-pyrazino[2,3-b][1,4]benzothiazine derivatives. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Bromo-2-nitrobenzoic acid | 98.0% | 4-Bromo-2-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Bromo-2-nitrobenzoic acid | 5-Bromo-2-nitrobenzoic acid is a building block in the chemical synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Hydroxy-5-nitrobenzoic acid, 99% | 99.88% | 2-Hydroxy-5-nitrobenzoic acid, 99% (Anilotic acid, 99%) is a basic chemical raw material and organic synthesis intermediate that can be used to synthesize Mesalamine (HY-15027). 2-Hydroxy-5-nitrobenzoic acid, 99% is a matrix for ultraviolet matrix-assisted laser desorption/ionization (UV-MALDI) mass spectrometry. 2-Hydroxy-5-nitrobenzoic acid, 99% can also serve as an HPLC analytical standard, pH indicator, and heavy metal detection agent. 2-Hydroxy-5-nitrobenzoic acid, 99% can also be used to study the oxidation of phenolic compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Methyl-2-nitrobenzoic acid | 99.83% | 2-Nitro-5-methylbenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Methyl-3-nitrobenzoic acid | 99.96% | 4-Methyl-3-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Chloro-5-nitrobenzoic acid | 2-Chloro-5-nitrobenzoic acid (Mesalazine impurity 1) is an impurity of 2-Chloro-5-nitrobenzoic acid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Nitrobenzoic acid | 99.91% | 3-Nitrobenzoic acid (m-Carboxynitrobenzene; m-Nitrobenzenecarboxylic acid; m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi. 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Amino-3-nitrobenzoic acid | 2-Amino-3-nitrobenzoic acid is a peroxide with antiviral activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Afatinib impurity 58 | Afatinib impurity 58 is an impurity of Afatinib (HY-10261). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
