65566-65-6
Chemical Structure
4-Hydroxyantipyrine-d3
Synonym(s): 4-Hydroxyphenazone-d3;NSC 174055-d3
- CAS. Nr.: 65566-65-6
- Formula:C11H9D3N2O2
- Molecular Weight:207.24
IUPAC Name: 4-hydroxy-5-methyl-1-(methyl-d3)-2-phenyl-1,2-dihydro-3H-pyrazol-3-one
InChIKey: SKVPTPMWXJSBTF-BMSJAHLVSA-N
SMILES: O=C1N(C2=CC=CC=C2)N(C(C)=C1O)C([2H])([2H])[2H]
Biological Activity: 4-Hydroxyantipyrine-d3 is the deuterium labeled 4-Hydroxyantipyrine. 4-Hydroxyantipyrine is the major metabolite of Antipyrine, can be as a biodistribution promoter. 4-Hydroxyantipyrine can increase distribution of concentration ratio of Antipyrine in the brain[1][2][3].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Hydroxyantipyrine-d3 | 4-Hydroxyantipyrine-d3 is the deuterium labeled 4-Hydroxyantipyrine. 4-Hydroxyantipyrine is the major metabolite of Antipyrine, can be as a biodistribution promoter. 4-Hydroxyantipyrine can increase distribution of concentration ratio of Antipyrine in the brain. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Hydroxyantipyrine (Standard) | ≥98% | 4-Hydroxyantipyrine (Standard) is the analytical standard of 4-Hydroxyantipyrine. This product is intended for research and analytical applications. 4-Hydroxyantipyrine (4-Hydroxyphenazone; NSC 174055) is the major metabolite of Antipyrine (HY-B0171), can be as a biodistribution promoter. 4-Hydroxyantipyrine can increase distribution of concentration ratio of Citicoline and Antipyrine in the brain. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Hydroxyantipyrine | 99.9% | 4-Hydroxyantipyrine (4-Hydroxyphenazone; NSC 174055) is the major metabolite of Antipyrine (HY-B0171), can be as a biodistribution promoter. 4-Hydroxyantipyrine can increase distribution of concentration ratio of Citicoline and Antipyrine in the brain. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||