6610-25-9
Chemical Structure
Arachidonic acid sodium salt
Synonym(s): Immunocytophyt sodium salt
- CAS No.: 6610-25-9
- Formula:C20H31NaO2
- Molecular Weight:326.45
IUPAC Name: sodium (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate
InChIKey: DDMGAAYEUNWXSI-XVSDJDOKSA-M
SMILES: CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(O[Na])=O
Biological Activity: Arachidonic acid (Immunocytophyt) sodium salt is a polyunsaturated omega-6 fatty acid and a major constituent of biomembranes. Arachidonic acid sodium salt also acts as the substrate for various lipid mediators, such as prostaglandins (PGs). Arachidonic acid sodium salt improves cognitive response and cardiovascular function[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arachidonic acid sodium salt | 98.99% | Arachidonic acid (Immunocytophyt) sodium salt is a polyunsaturated omega-6 fatty acid and a major constituent of biomembranes. Arachidonic acid sodium salt also acts as the substrate for various lipid mediators, such as prostaglandins (PGs). Arachidonic acid sodium salt improves cognitive response and cardiovascular function. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||