7075-11-8
Chemical Structure
Cytarabine 5’-monophosphate
- CAS No.: 7075-11-8
- Formula:C9H14N3O8P
- Molecular Weight:323.20
IUPAC Name: 5-amino-1H-isochromen-1-one
InChIKey: IERHLVCPSMICTF-CCXZUQQUSA-N
SMILES: O[C@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H]1N2C(N=C(N)C=C2)=O
Biological Activity: Cytarabine 5′-monophosphate is a metabolite of the nucleoside analog Cytarabine (HY-13605), catalyzed by deoxycytidine kinase. Cytarabine 5′-monophosphate is incorporated into DNA by DNA polymerase α, which reduces the rate of DNA synthesis. At a concentration of 15 mM, Cytarabine 5′-monophosphate inhibits nuclear and mitochondrial DNA replication in Saccharomyces cerevisiae (S. cerevisiae). Additionally, Cytarabine 5′-monophosphate (3.5-75.1 mg/kg) improves survival in leukemia mice (L1210 mice). Cytarabine 5′-monophosphate can be used in cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cytarabine 5’-monophosphate | 98.04% | Cytarabine 5′-monophosphate is a metabolite of the nucleoside analog Cytarabine (HY-13605), catalyzed by deoxycytidine kinase. Cytarabine 5′-monophosphate is incorporated into DNA by DNA polymerase α, which reduces the rate of DNA synthesis. At a concentration of 15 mM, Cytarabine 5′-monophosphate inhibits nuclear and mitochondrial DNA replication in Saccharomyces cerevisiae (S. cerevisiae). Additionally, Cytarabine 5′-monophosphate (3.5-75.1 mg/kg) improves survival in leukemia mice (L1210 mice). Cytarabine 5′-monophosphate can be used in cancer research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytarabine-13C3 5'-monophosphate | Cytarabine-13C3 5'-monophosphate is 13C labeled Cytarabine 5’-monophosphate. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
