71865-37-7
Chemical Structure
DTME
Synonym(s): Dithio-bis-maleimidoethane
- CAS No.: 71865-37-7
- Formula:C12H12N2O4S2
- Molecular Weight:312.36
IUPAC Name: 1,1'-(disulfanediylbis(ethane-2,1-diyl))bis(1H-pyrrole-2,5-dione)
InChIKey: SGVWDRVQIYUSRA-UHFFFAOYSA-N
SMILES: O=C(C=C1)N(CCSSCCN2C(C=CC2=O)=O)C1=O
Biological Activity: DTME (dithio-bis-maleimidoethane) is a homobifunctional, maleimide crosslinker specifically designed for conjugation between sulfhydryl groups (-SH). DTME, whose molecular structure consists of two maleimide groups connected by an ethylene disulfide bridge, can specifically react with thiol - containing molecules (such as cysteine residues) to form stable covalent bonds. DTME allows crosslinks that can be cleaved with reducing agents such as DTT (HY-15917). DTME is commonly utilized to explore and characterize protein structure, particularly oligomerization, or protein interactions[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DTME | 99.03% | DTME (dithio-bis-maleimidoethane) is a homobifunctional, maleimide crosslinker specifically designed for conjugation between sulfhydryl groups (-SH). DTME, whose molecular structure consists of two maleimide groups connected by an ethylene disulfide bridge, can specifically react with thiol - containing molecules (such as cysteine residues) to form stable covalent bonds. DTME allows crosslinks that can be cleaved with reducing agents such as DTT (HY-15917). DTME is commonly utilized to explore and characterize protein structure, particularly oligomerization, or protein interactions. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
