77-40-7
Chemical Structure
Bisphenol B
- CAS No.: 77-40-7
- Formula:C16H18O2
- Molecular Weight:242.31
IUPAC Name: 4,4'-(Butane-2,2-diyl)diphenol
InChIKey: HTVITOHKHWFJKO-UHFFFAOYSA-N
SMILES: CCC(C1=CC=C(O)C=C1)(C2=CC=C(O)C=C2)C
Biological Activity: Bisphenol B is a close structural analog of Bisphenol A (BPA) (HY-18260). Bisphenol B is a potent, orally active endocrine disruptor (ED). Bisphenol B binds to G protein-coupled estrogen receptor (GPER) (IC50 = 3.3 μM) with higher affinity and agonistic activity than BPA. Bisphenol B promotes GPER mediated cell migration. Bisphenol B exerts estrogenic effects via GPER pathway at nanomolar concentration. Bisphenol B is used in the manufacture of polycarbonate resin with ED properties[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Bisphenol B | 99.34% | Bisphenol B is a close structural analog of Bisphenol A (BPA) (HY-18260). Bisphenol B is a potent, orally active endocrine disruptor (ED). Bisphenol B binds to G protein-coupled estrogen receptor (GPER) (IC50 = 3.3 μM) with higher affinity and agonistic activity than BPA. Bisphenol B promotes GPER mediated cell migration. Bisphenol B exerts estrogenic effects via GPER pathway at nanomolar concentration. Bisphenol B is used in the manufacture of polycarbonate resin with ED properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bisphenol B (Standard) | ≥98% | Bisphenol B (Standard) is the analytical standard of Bisphenol B. This product is intended for research and analytical applications. Bisphenol B is a close structural analog of Bisphenol A (BPA) (HY-18260). Bisphenol B is a potent, orally active endocrine disruptor (ED). Bisphenol B binds to G protein-coupled estrogen receptor (GPER) (IC50 = 3.3 μM) with higher affinity and agonistic activity than BPA. Bisphenol B promotes GPER mediated cell migration. Bisphenol B exerts estrogenic effects via GPER pathway at nanomolar concentration. Bisphenol B is used in the manufacture of polycarbonate resin with ED properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bisphenol B-13C12 | Bisphenol B-13C12 is 13C labeled Bisphenol B. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bisphenol B-d8 | 98.89% | Bisphenol B-d8 is the deuterium labeled Bisphenol B (HY-W013935). Bisphenol B is a very close structural analog of Bisphenol A (HY-18260), an endocrine disrupting chemical (EDC). Bisphenol B shows endocrine disruptive properties or other adverse effects on animal models. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Serra H, et al. Evidence for Bisphenol B Endocrine Properties: Scientific and Regulatory Perspectives. Environ Health Perspect. 2019 Oct;127(10):106001. [Content Brief]
- [2]. Grumetto, L., et al., (2008). Determination of bisphenol a and bisphenol B residues in canned peeled tomatoes by reversed-phase liquid chromatography. Journal of agricultural and food chemistry, 56(22), 10633–10637. [Content Brief]
- [3]. Cao, L. Y., et al., (2017). Bisphenol AF and Bisphenol B Exert Higher Estrogenic Effects than Bisphenol A via G Protein-Coupled Estrogen Receptor Pathway. Environmental science & technology, 51(19), 11423–11430. [Content Brief]
