81907-65-5
Chemical Structure
Methyl Ganoderic acid B
- CAS No.: 81907-65-5
- Formula:C31H46O7
- Molecular Weight:530.69
IUPAC Name: methyl (2R,6R)-6-((3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxoheptanoate
InChIKey: RDZRNUXQSVYSHW-BGJMPESVSA-N
SMILES: C[C@]12C3=C(C(C[C@@]1([C@@](CC2=O)([H])[C@H](C)CC(C[C@@H](C)C(OC)=O)=O)C)=O)[C@@]4([C@@](C(C)([C@H](CC4)O)C)([H])C[C@@H]3O)C
Biological Activity: Methyl Ganoderic acid B is a triterpenoid, that can be isolated from Ganoderma lucidum. Methyl Ganoderic acid B has nerve growth factor-like neuronal survival-promoting effects[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Methyl Ganoderic acid B | Methyl Ganoderic acid B is a triterpenoid, that can be isolated from Ganoderma lucidum. Methyl Ganoderic acid B has nerve growth factor-like neuronal survival-promoting effects. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||