82952-64-5
Chemical Structure
Trimetrexate glucuronate
Synonym(s): CI-898 glucuronate
- CAS. Nr.: 82952-64-5
- Formula:C25H33N5O10
- Molecular Weight:563.56
IUPAC Name: 5-methyl-6-(((3,4,5-trimethoxyphenyl)amino)methyl)quinazoline-2,4-diamine (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate
InChIKey: ZCJXQWYMBJYJNB-LRDBBFHQSA-N
SMILES: O=C[C@@H]([C@H]([C@@H]([C@@H](C(O)=O)O)O)O)O.NC1=NC(N)=C2C(C)=C(CNC3=CC(OC)=C(OC)C(OC)=C3)C=CC2=N1
Biological Activity: Trimetrexate glucuronate (NSC 352122) is a folic acid antagonist. Trimetrexate glucuronate affects DNA and RNA synthesis by inhibiting dihydrofolate reductase and preventing the synthesis of purine nucleotides and thymidylate. Trimetrexate glucuronate has potential antitumour activity and can also be used to inhibit Pneumocystis carinii pneumonia[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trimetrexate glucuronate | 98.09% | Trimetrexate glucuronate (NSC 352122) is a folic acid antagonist. Trimetrexate glucuronate affects DNA and RNA synthesis by inhibiting dihydrofolate reductase and preventing the synthesis of purine nucleotides and thymidylate. Trimetrexate glucuronate has potential antitumour activity and can also be used to inhibit Pneumocystis carinii pneumonia. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimetrexate glucuronate (Standard) | ≥98% | Trimetrexate (glucuronate) (Standard) is the analytical standard of Trimetrexate (glucuronate). This product is intended for research and analytical applications. Trimetrexate glucuronate (NSC 352122) is a folic acid antagonist. Trimetrexate glucuronate affects DNA and RNA synthesis by inhibiting dihydrofolate reductase and preventing the synthesis of purine nucleotides and thymidylate. Trimetrexate glucuronate has potential antitumour activity and can also be used to inhibit Pneumocystis carinii pneumonia. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||