83852-56-6
Chemical Structure
Chrysomycin B
- CAS No.: 83852-56-6
- Formula:C27H28O9
- Molecular Weight:496.51
IUPAC Name: 1-hydroxy-10,12-dimethoxy-8-methyl-4-((2S,3S,4R,5S,6R)-3,4,5-trihydroxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)-6H-dibenzo[c,h]chromen-6-one
InChIKey: BJPYMDSMDBCKEP-QSMCFSHASA-N
SMILES: O=C1C2=CC(C)=CC(OC)=C2C3=CC(OC)=C4C(O)=CC=C([C@H]5[C@@H]([C@]([C@H]([C@@H](C)O5)O)(C)O)O)C4=C3O1
Biological Activity: Chrysomycin B is an antibiotic isolated from a strain of Streptomyces. Chrysomycin B causes DNA damage in the human lung adenocarcinoma A549 cell line and inhibits topoisomerase II. Chrysomycin B suppresses the growth of transplantable tumors in mice.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chrysomycin B | Chrysomycin B is an antibiotic isolated from a strain of Streptomyces. Chrysomycin B causes DNA damage in the human lung adenocarcinoma A549 cell line and inhibits topoisomerase II. Chrysomycin B suppresses the growth of transplantable tumors in mice. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
