91032-26-7
Chemical Structure
Teicoplanin A2-2
- CAS No.: 91032-26-7
- Formula:C88H97Cl2N9O33
- Molecular Weight:1879.66
InChIKey: GHOXVFYORXUCPY-PKMGYIMSSA-N
SMILES: CC(CCCCCCC(N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC2=C3C=C4C=C2OC5=C(Cl)C=C([C@@H](O[C@H]6[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O6)[C@H]7C(N[C@H](C(O)=O)C8=C(C9=C(O)C=CC([C@@H](NC([C@@H]4NC([C@@H]%10C%11=CC(O)=CC(OC%12=C(O)C=CC([C@@H](N)C(N[C@@H](C(N%10)=O)CC%13=CC(Cl)=C(C=C%13)O3)=O)=C%12)=C%11)=O)=O)C(N7)=O)=C9)C(O[C@@H]%14[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O%14)=CC(O)=C8)=O)C=C5)=O)C
Biological Activity: Teicoplanin A2-2 is a glycopeptide antibiotic. Teicoplanin A2-2 exhibits antibacterial activity, particularly against coagulase-negative staphylococci (CNS). Teicoplanin A2-2 inhibits bacterial cell wall synthesis by competitively binding to the terminal D-Ala-D-Ala peptide bonds in the cell wall synthesis process, leading to bacterial death. Teicoplanin A2-2 can be used for research into bacterial resistance mechanisms and the development of new antibiotics[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Teicoplanin A2-2 | 97.8% | Teicoplanin A2-2 is a glycopeptide antibiotic. Teicoplanin A2-2 exhibits antibacterial activity, particularly against coagulase-negative staphylococci (CNS). Teicoplanin A2-2 inhibits bacterial cell wall synthesis by competitively binding to the terminal D-Ala-D-Ala peptide bonds in the cell wall synthesis process, leading to bacterial death. Teicoplanin A2-2 can be used for research into bacterial resistance mechanisms and the development of new antibiotics. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords