95051-10-8
Chemical Structure
5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin
- CAS No.: 95051-10-8
- Formula:C45H30N4O2
- Molecular Weight:658.75
IUPAC Name: 4-(10,15,20-triphenylporphyrin-5-yl)benzoic acid
InChIKey: GZTMFXHPFNRUNU-LWQDQPMZSA-N
SMILES: O=C(C1=CC=C(/C2=C3C=CC(/C(C4=CC=CC=C4)=C5C=C/C(N/5)=C(C6=CC=CC=C6)/C(C=C/7)=NC7=C(C8=CC=CC=C8)/C9=CC=C2N9)=N\3)C=C1)O
Biological Activity: 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin is a porphyrin compound. 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin exhibits virucidal effects of 85% and 60% against HSV-1 and HSV-2, respectively. 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin has a maximum noncytotoxic studied concentration of 5 μg/mL on Vero cells. 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin can be used for the synthesis of compounds with stronger antiviral activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin | ≥97.0% | 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin is a porphyrin compound. 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin exhibits virucidal effects of 85% and 60% against HSV-1 and HSV-2, respectively. 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin has a maximum noncytotoxic studied concentration of 5 μg/mL on Vero cells. 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin can be used for the synthesis of compounds with stronger antiviral activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
