96157-95-8
Chemical Structure
Pervicoside B
- CAS No.: 96157-95-8
- Formula:C54H85NaO25S
- Molecular Weight:1189.29
IUPAC Name: sodium (3R,4R,5R,6S)-5-(((2S,3R,4R,5S,6R)-5-(((2S,3R,4S,5R,6R)-4-(((2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxytetrahydro-2H-pyran-2-yl)oxy)-3,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-3,4-dihydroxy-6-methyltetrahydro-2H-pyr
InChIKey: VWVFDNQLFDTCOH-FCJJUEQSSA-M
SMILES: O[C@H]1[C@@H]([C@H]([C@](O[C@H]2[C@@H]([C@H](O[C@@](O[C@H]3[C@@H]([C@H]([C@](O[C@@H]4[C@H]([C@@H](CO[C@@]4([H])O[C@H]5CC[C@]6([C@]([H])(C5(C)C)CCC7C6=C[C@@H](C89[C@]7(CC[C@@]8([C@@](C)(OC9=O)CC/C=C(C)/C)[H])C)O)C)OS(=O)(O[Na])=O)O)(O[C@@H]3C)[H])O)O)([C@@H]2O)[H])CO)O)(O[C@@H]1CO)[H])O)OC
Biological Activity: Pervicoside B is a glycoside C isolated from Neothyone gibbosa sea cucumber. In vitro studies have shown that Pervicoside B has a potent antiparasitic effect against Leishmania mexicana, inhibiting 100% of promastigotes at 5-10 μg/mL. Pervicoside B also exhibits strong antifungal activity against Aspergillus niger, with MIC values ranging from 4.65 to 16.7 μg/mL. Pervicoside B has potential applications in the inhibition of parasitic infections and fungal diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pervicoside B | Pervicoside B is a glycoside C isolated from Neothyone gibbosa sea cucumber. In vitro studies have shown that Pervicoside B has a potent antiparasitic effect against Leishmania mexicana, inhibiting 100% of promastigotes at 5-10 μg/mL. Pervicoside B also exhibits strong antifungal activity against Aspergillus niger, with MIC values ranging from 4.65 to 16.7 μg/mL. Pervicoside B has potential applications in the inhibition of parasitic infections and fungal diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
