99260-67-0
Chemical Structure
Saquayamycin B
- CAS No.: 99260-67-0
- Formula:C43H48O16
- Molecular Weight:820.83
IUPAC Name: (3R,4aR,12bS)-9-((2S,4aS,5aR,7R,9R,9aR,10aR)-2,9-dimethyl-3-oxooctahydro-2H,7H-dipyrano[2,3-b:4',3'-e][1,4]dioxin-7-yl)-4a,8,12b-trihydroxy-3-methyl-3-(((2S,5S,6S)-6-methyl-5-(((2R,6S)-6-methyl-5-oxo-5,6-dihydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)
InChIKey: WUQKUPKWGZHYBN-NIVOMPQSSA-N
SMILES: O=C1C[C@@](O[C@H]2CC[C@H](O[C@H]3C=CC([C@H](C)O3)=O)[C@H](C)O2)(C)C[C@]4(O)[C@@]1(O)C(C(C5=CC=C([C@H]6C[C@@]7([H])O[C@](CC([C@H](C)O8)=O)([H])[C@]8([H])O[C@]7([H])[C@@H](C)O6)C(O)=C5C9=O)=O)=C9C=C4
Biological Activity: Saquayamycin B (compound 3) is a new angucycline antibiotic. Saquayamycin B has antitumor activities against a human lung (H-460) and a human breast cancer cell line (MCF-7) with GI50 values of 12.2 and 15.2 µM respectively [1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Saquayamycin B | Saquayamycin B (compound 3) is a new angucycline antibiotic. Saquayamycin B has antitumor activities against a human lung (H-460) and a human breast cancer cell line (MCF-7) with GI50 values of 12.2 and 15.2 µM respectively . | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||