112430-63-4
Chemical Structure
Ganodermic acid S
- CAS. Nr.: 112430-63-4
- Formula:C34H50O6
- Molecular Weight:554.76
IUPAC Name: (R,E)-6-((3S,5R,10S,13R,14R,15S,17R)-3,15-diacetoxy-4,4,10,13,14-pentamethyl-2,3,4,5,6,10,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid
InChIKey: OTUZGGSAOMCYNC-CRTLAZRUSA-N
SMILES: CC1([C@H](CC[C@@]2(C3=CC[C@@]4([C@H](C[C@@H]([C@]4(C3=CC[C@@]12[H])C)OC(C)=O)[C@@H](CC/C=C(C(O)=O)\C)C)C)C)OC(C)=O)C
Biological Activity: Ganodermic acid S is an oxygenated triterpenoid, that can be isolated from the Chinese medicinal fungus Ganoderma lucidum (Fr.) Karst (Polyporaceae). Ganodermic acid S exerts a concentration dependent inhibition on the response of human gel-filtered platelets (GFP) to U-46619 (HY-108566), a thromboxane (TX) A2 mimetic[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ganodermic acid S | Ganodermic acid S is an oxygenated triterpenoid, that can be isolated from the Chinese medicinal fungus Ganoderma lucidum (Fr.) Karst (Polyporaceae). Ganodermic acid S exerts a concentration dependent inhibition on the response of human gel-filtered platelets (GFP) to U-46619 (HY-108566), a thromboxane (TX) A2 mimetic. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
