1151-98-0
Chemical Structure
Apigeninidin chloride
Synonym(s): Gesneridin chloride; Apigenidin chloride
- CAS. Nr.: 1151-98-0
- Formula:C15H11ClO4
- Molecular Weight:290.70
IUPAC Name: 5,7-dihydroxy-2-(4-hydroxyphenyl)chromenylium chloride
InChIKey: GYQDOAKHUGURPD-UHFFFAOYSA-N
SMILES: OC1=CC(O)=C2C=CC(C3=CC=C(C=C3)O)=[O+]C2=C1.[Cl-]
Biological Activity: Apigeninidin chloride (Gesneridin chloride; Apigenidin chloride) is a naturally occurring 3-deoxyanthocyanidin flavonoid phytoalexin. Apigeninidin chloride inhibits fungal spore germination by delaying germination. Apigeninidin chloride induces ROS and mitochondrial superoxide production in Toxoplasma gondii tachyzoites, disrupts mitochondrial membrane potential, and promotes oxidative stress-induced lipid peroxidation and the generation of oxidized lipid metabolites. Apigeninidin can be used in research related to fungal infections and toxoplasmosis[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Apigeninidin chloride | Apigeninidin chloride (Gesneridin chloride; Apigenidin chloride) is a naturally occurring 3-deoxyanthocyanidin flavonoid phytoalexin. Apigeninidin chloride inhibits fungal spore germination by delaying germination. Apigeninidin chloride induces ROS and mitochondrial superoxide production in Toxoplasma gondii tachyzoites, disrupts mitochondrial membrane potential, and promotes oxidative stress-induced lipid peroxidation and the generation of oxidized lipid metabolites. Apigeninidin can be used in research related to fungal infections and toxoplasmosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Spinelli F, et al. Luteoforol, a flavan 4-ol, is induced in pome fruits by prohexadione-calcium and shows phytoalexin-like properties against Erwinia amylovora and other plant pathogens. Eur J Plant Pathol, 2005, 112: 133-142.
- [2]. Moon M J, et al. Apigeninidin chloride disrupts Toxoplasma gondii Mitochondrial membrane potential and induce reactive oxygen species and metabolites production. Front. Cell. Infect. Microbiol., 2024, 14.
