129541-41-9
Chemical Structure
X-Gluc sodium
- CAS No.: 129541-41-9
- Formula:C14H12BrClNNaO7
- Molecular Weight:444.59
IUPAC Name: sodium (2S,3S,4S,5R,6S)-6-((5-bromo-4-chloro-1H-indol-3-yl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate
InChIKey: IBLSVGDGSKUDCT-CYRSAHDMSA-M
SMILES: O[C@H]([C@H]([C@@H]([C@@H](C(O[Na])=O)O1)O)O)[C@@H]1OC2=CNC3=C2C(Cl)=C(Br)C=C3
Biological Activity: X-Gluc sodium is a dye reagent for the detection of β-glucuronidase (GUS), an enzyme produced by E. coli. X-Gluc sodium can be used to detect E. coli contamination in food, water and the urinary tract (GUS as a specific detection indicator). X-Gluc sodium is also widely used in molecular biology experiments to label and detect the expression of target genes (reacts with the GUS gene, appears blue)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
X-Gluc sodium | 98.0% | X-Gluc sodium is a dye reagent for the detection of β-glucuronidase (GUS), an enzyme produced by E. coli. X-Gluc sodium can be used to detect E. coli contamination in food, water and the urinary tract (GUS as a specific detection indicator). X-Gluc sodium is also widely used in molecular biology experiments to label and detect the expression of target genes (reacts with the GUS gene, appears blue). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
