2097138-89-9
2097138-89-9
Chemical Structure
(2R)-Kazinol B
- CAS No.: 2097138-89-9
- Formula:C25H28O4
- Molecular Weight:392.49
InChIKey: QSCBHDIGHKHWKC-OAQYLSRUSA-N
SMILES: C/C(C)=C\CC1=C([C@@H]2OC3=CC(O)=CC=C3CC2)C=C4C(OC(C)(C=C4)C)=C1O
Biological Activity: (2R)-Kazinol B is a prenylated flavane enantiomer found in the stem and root barks of Daphne giraldii, and it is also an isomer of Kazinol B (HY-N3426). (2R)-Kazinol B exerts selective cytotoxicity against liver cancer cells, induces apoptosis via both intrinsic and extrinsic pathways, and triggers protective autophagy through AMPK activation. (2R)-Kazinol B can be used in the research of liver cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(2R)-Kazinol B | (2R)-Kazinol B is a prenylated flavane enantiomer found in the stem and root barks of Daphne giraldii, and it is also an isomer of Kazinol B (HY-N3426). (2R)-Kazinol B exerts selective cytotoxicity against liver cancer cells, induces apoptosis via both intrinsic and extrinsic pathways, and triggers protective autophagy through AMPK activation. (2R)-Kazinol B can be used in the research of liver cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
