2483830-18-6
Chemical Structure
Deoxythymidine-5'-triphosphate-13C10,15N2 dilithium
Synonym(s): dTTP-13C10,15N2 dilithium
- CAS No.: 2483830-18-6
- Formula:13C10H15Li215N2O14P3
- Molecular Weight:505.95
InChIKey: HGQGGFXJPYJQGW-XQKKEPRHSA-L
SMILES: O=[13C]([15N]1[13C@H]2[13CH2][13C@H](O)[13C@@H]([13CH2]OP(O)(OP(OP(O)(O[Li])=O)(O[Li])=O)=O)O2)[15NH][13C]([13C]([13CH3])=[13CH]1)=O
Biological Activity: Deoxythymidine-5'-triphosphate-13C10,15N2 dilithium (dTTP-13C10,15N2 dilithium) is the 13C, 15N-labeled Deoxythymidine-5'-triphosphate (HY-138615). Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia[1][2].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Deoxythymidine-5'-triphosphate-13C10,15N2 dilithium | Deoxythymidine-5'-triphosphate-13C10,15N2 dilithium (dTTP-13C10,15N2 dilithium) is the 13C, 15N-labeled Deoxythymidine-5'-triphosphate (HY-138615). Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxythymidine-5'-triphosphate-15N2 dilithium | 99.0% | Deoxythymidine-5'-triphosphate-15N2 dilithium (dTTP-15N2 dilithium) is the 15N-labeled Deoxythymidine-5'-triphosphate (HY-138615). Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxythymidine-5'-triphosphate-15N2,d15 dilithium | Deoxythymidine-5'-triphosphate-15N2,d15 dilithium (dTTP-15N2,d15 dilithium) is the deuterated, 15N-labeled Deoxythymidine-5'-triphosphate (HY-138615). Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxythymidine-5'-triphosphate-d15 dilithium | Deoxythymidine-5'-triphosphate-d15 dilithium (dTTP-d15 dilithium) is the deuterated-labeled Deoxythymidine-5'-triphosphate (HY-138615). Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxythymidine-5'-triphosphate-13C10 dilithium | 99.1% | Deoxythymidine-5'-triphosphate-13C10 dilithium (dTTP-13C10 dilithium) is the 13C-labeled Deoxythymidine-5'-triphosphate (HY-138615). Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxythymidine-5'-triphosphate | Deoxythymidine-5'-triphosphate (dTTP) is a deoxyribonucleoside triphosphate and a thymidine analog, which serves as a direct precursor for DNA synthesis. Deoxythymidine-5'-triphosphate can be used for DNA amplification in the DNA polymerase chain reaction (PCR). Deoxythymidine-5'-triphosphate is also applicable to research related to diseases such as leukemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Tattersall MH, et al. Deoxyribonucleoside triphosphates in human cells: changes in disease and following exposure to drugs. European journal of clinical investigation. 1975 Apr;5(2):191-202. [Content Brief]
- [2]. Rondan Dueñas JC, et al. Specific requirements for PCR amplification of long mitochondrial A+T-rich DNA. Biotechniques. 1999 Aug;27(2):258-60. [Content Brief]