2728727-91-9
Chemical Structure
GSK137
- CAS No.: 2728727-91-9
- Formula:C21H19FN6
- Molecular Weight:374.41
IUPAC Name: 5-((5S,7R)-3-fluoro-7-(2-methylpyridin-3-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl)quinolin-2-amine
InChIKey: WSRZNMRSHUJOED-RBUKOAKNSA-N
SMILES: FC1=C(N2N=C1)N[C@@H](C[C@@H]2C3=C(N=CC=C3)C)C4=CC=CC5=C4C=CC(N)=N5
Biological Activity: GSK137 is an orally active, potent and selective B-cell lymphoma 6 (BCL6) inhibitor. GSK137 blocks the interaction between BCL6 and corepressors (e.g., SMRT), reducing the number of germinal center B cells. GSK137 is promising for research of autoimmune diseases such as systemic lupus erythematosus (SLE) and B-cell-related tumors such as diffuse large B-cell lymphoma[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
GSK137 | GSK137 is an orally active, potent and selective B-cell lymphoma 6 (BCL6) inhibitor. GSK137 blocks the interaction between BCL6 and corepressors (e.g., SMRT), reducing the number of germinal center B cells. GSK137 is promising for research of autoimmune diseases such as systemic lupus erythematosus (SLE) and B-cell-related tumors such as diffuse large B-cell lymphoma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
