3029447-08-0
Chemical Structure
IGF2BP1-IN-1
- CAS No.: 3029447-08-0
- Formula:C42H52FN3O10
- Molecular Weight:777.87
InChIKey: TYPLITLLZBGXGF-UAXPXNTJSA-N
SMILES: C[C@]12[C@@]3([H])[C@]([C@@]4([H])C(C(C)(C([C@H](C4)OC(CN5C(N(C6=CC=C(C=C6)F)C=N5)=O)=O)=O)C)=CC3)(C(C[C@@]1([C@@]([C@@H](C2)O)([H])[C@@](C)(O)C(/C=C/C(C)(C)OC(C)=O)=O)C)=O)C
Biological Activity: IGF2BP1-IN-1, a Cucurbitacin B (HY-N0416) derivative, is a potent IGF2BP1 inhibitor (KD = 2.88 nM). IGF2BP1-IN-1 binds directly to IGF2BP1, thereby inducing tumor cell cycle arrest, increasing apoptosis, and reducing autophagy. IGF2BP1-IN-1 can be used in research on NSLSC, colon, breast, liver, ovarian, pancreatic, and cervical cancers[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
IGF2BP1-IN-1 | 99.94% | IGF2BP1-IN-1, a Cucurbitacin B (HY-N0416) derivative, is a potent IGF2BP1 inhibitor (KD = 2.88 nM). IGF2BP1-IN-1 binds directly to IGF2BP1, thereby inducing tumor cell cycle arrest, increasing apoptosis, and reducing autophagy. IGF2BP1-IN-1 can be used in research on NSLSC, colon, breast, liver, ovarian, pancreatic, and cervical cancers. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||