32719-11-2
Chemical Structure
(Z)-Neochlorogenic acid
Synonym(s): cis-5-O-Caffeoylquinic acid
- CAS. Nr.: 32719-11-2
- Formula:C16H18O9
- Molecular Weight:354.31
InChIKey: CWVRJTMFETXNAD-DJTMHQFBSA-N
SMILES: OC(C=C1/C=C\C(O[C@@H]2C[C@](O)(C[C@H]([C@@H]2O)O)C(O)=O)=O)=C(C=C1)O
Biological Activity: (Z)-Neochlorogenic acid is the z-isomer of Neochlorogenic acid (HY-N0722). Neochlorogenic acid is a natural polyphenolic compound found in dried fruits and other plants. Neochlorogenic acid inhibits the production of TNF-α and IL-1β. Neochlorogenic acid suppresses iNOS and COX-2 protein expression. Neochlorogenic acid also inhibits phosphorylated NF-κB p65 and p38 MAPK activation[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(Z)-Neochlorogenic acid | (Z)-Neochlorogenic acid is the z-isomer of Neochlorogenic acid (HY-N0722). Neochlorogenic acid is a natural polyphenolic compound found in dried fruits and other plants. Neochlorogenic acid inhibits the production of TNF-α and IL-1β. Neochlorogenic acid suppresses iNOS and COX-2 protein expression. Neochlorogenic acid also inhibits phosphorylated NF-κB p65 and p38 MAPK activation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
