83-44-3
83-44-3
Chemical Structure
Deoxycholic acid
Synonym(s): Cholanoic acid; Desoxycholic acid
- CAS No.: 83-44-3
- Formula:C24H40O4
- Molecular Weight:392.57
IUPAC Name: (R)-4-((3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid
InChIKey: KXGVEGMKQFWNSR-LLQZFEROSA-N
SMILES: C[C@@]1([C@@]2([H])[C@H](C)CCC(O)=O)[C@](CC2)([H])[C@@](CC[C@@]3([H])[C@@]4(CC[C@@H](O)C3)C)([H])[C@]4([H])C[C@@H]1O
Biological Activity: Deoxycholic acid (cholanoic acid), a bile acid, is a by-product of intestinal metabolism, that activates the G protein-coupled bile acid receptorTGR5[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Deoxycholic acid | 99.94% | Deoxycholic acid (cholanoic acid), a bile acid, is a by-product of intestinal metabolism, that activates the G protein-coupled bile acid receptorTGR5. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid (Standard) | 99.85% | Deoxycholic acid (Standard) is the analytical standard of Deoxycholic acid. This product is intended for research and analytical applications. Deoxycholic acid (cholanoic acid), a bile acid, is a by-product of intestinal metabolism, that activates the G protein-coupled bile acid receptorTGR5. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-d5 | 99.9% | Deoxycholic acid-d5 is the deuterium labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-d4 | 99.80% | Deoxycholic acid-d4 is the deuterium labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-d6 | 99.70% | Deoxycholic acid-d6 is the deuterium labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-13C | 98.0% | Deoxycholic acid-13C is the 13C-labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Somm E, et al. β-Klotho deficiency protects against obesity through a crosstalk between liver, microbiota, and brown adipose tissue. JCI Insight. 2017 Apr 20;2(8). pii: 91809. [Content Brief]
- [2]. Wang X, et al. Acidified bile acids enhance tumor progression and telomerase activity of gastric cancer in micedependent on c-Myc expression. Cancer Med. 2017 Apr;6(4):788-797. [Content Brief]
