835616-61-0
Chemical Structure
Thalidomide 5-fluoride
- CAS No.: 835616-61-0
- Formula:C13H9FN2O4
- Molecular Weight:276.22
IUPAC Name: 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione
InChIKey: MPQLCQKBYRSPNA-UHFFFAOYSA-N
SMILES: O=C1N(C(CC2)C(NC2=O)=O)C(C3=C1C=CC(F)=C3)=O
Biological Activity: Thalidomide 5-fluoride is a thalidomide-based Cereblon ligand used to recruit Cereblon protein. Thalidomide 5-fluoride can be linked to target protein ligands (e.g. IRAK4) through a linker to form PROTAC molecules (e.g. PROTAC IRAK4 degrader-1). PROTAC IRAK4 degrader-1 caused <20%, >20-50%, and >50% IRAK4 protein degradation in OCI-LY-10 cells at concentrations of 0.01, 0.1, and 1 μM, respectively[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Thalidomide 5-fluoride | 99.96% | Thalidomide 5-fluoride is a thalidomide-based Cereblon ligand used to recruit Cereblon protein. Thalidomide 5-fluoride can be linked to target protein ligands (e.g. IRAK4) through a linker to form PROTAC molecules (e.g. PROTAC IRAK4 degrader-1). PROTAC IRAK4 degrader-1 caused <20%, >20-50%, and >50% IRAK4 protein degradation in OCI-LY-10 cells at concentrations of 0.01, 0.1, and 1 μM, respectively. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||