86770-68-5
Chemical Structure
Azido-PEG5-alcohol
- CAS. Nr.: 86770-68-5
- Formula:C10H21N3O5
- Molecular Weight:263.29
IUPAC Name: 14-azido-3,6,9,12-tetraoxatetradecan-1-ol
InChIKey: JTGGTGKXQQGEHB-UHFFFAOYSA-N
SMILES: OCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG5-alcohol is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azido-PEG5-alcohol is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[2]. Azido-PEG5-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG5-alcohol | 97.0% | Azido-PEG5-alcohol is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG5-alcohol is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG5-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
