92562-77-1
Chemical Structure
3′-Azido-2′,3′-dideoxy-CTP
Synonym(s): AZddCTP
- CAS. Nr.: 92562-77-1
- Formula:C9H15N6O12P3
- Molecular Weight:492.17
InChIKey: KTLCZHWMPHUXRA-SHYZEUOFSA-N
SMILES: O=P(OP(OP(O)(O)=O)(O)=O)(O)OC[C@H]1O[C@@H](N2C(N=C(N)C=C2)=O)C[C@@H]1N=[N+]=[N-]
Biological Activity: 3′-Azido-2′,3′-dideoxy-CTP (AZddCTP) is a cytidine analog containing a 3-azido group. As a chain terminator, 3′-Azido-2′,3′-dideoxy-CTP can be incorporated into the nascent DNA chain by HIV reverse transcriptase. 3′-Azido-2′,3′-dideoxy-CTP terminates DNA synthesis due to the lack of a 3'-hydroxyl group, thereby inhibiting viral replication. 3′-Azido-2′,3′-dideoxy-CTP has IC50 values of 15.6 μM and 160.8 μM for WT HIV and AZTR HIV. 3′-Azido-2′,3′-dideoxy-CTP has antiviral activity[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3′-Azido-2′,3′-dideoxy-CTP | 3′-Azido-2′,3′-dideoxy-CTP (AZddCTP) is a cytidine analog containing a 3-azido group. As a chain terminator, 3′-Azido-2′,3′-dideoxy-CTP can be incorporated into the nascent DNA chain by HIV reverse transcriptase. 3′-Azido-2′,3′-dideoxy-CTP terminates DNA synthesis due to the lack of a 3'-hydroxyl group, thereby inhibiting viral replication. 3′-Azido-2′,3′-dideoxy-CTP has IC50 values of 15.6 μM and 160.8 μM for WT HIV and AZTR HIV. 3′-Azido-2′,3′-dideoxy-CTP has antiviral activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords