Rehmannic acid
Based on 1 Customer Validation
Rehmannic acid (lantadene A) is a compound isolated from Lantana camara. Rehmannic acid shows considerable in vitro antioxidant, free radical scavenging capacity activities in a dose dependant manner. Rehmannic acid is a promising candidate for use as an antioxidant and hepatoprotective agent.
For research use only. We do not sell to patients.
- Purity : 96.0%
- CAS No.: 467-81-2
- Formula: C35H52O5
- Molecular Weight:552.78
-
Storage:
4°C, protect from light
* In solvent : -80°C, 6 months; -20°C, 1 month (protect from light)
Biological Activity
Description
Cellular Effect
|
Cell Line
|
Type | Value | Description | References |
|---|---|---|---|---|
| 786-0 | GI50 |
3.47 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human 786-0 cells by sulforhodamine B assay
Growth inhibition of human 786-0 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| A498 | GI50 |
2.06 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human A498 cells by sulforhodamine B assay
Growth inhibition of human A498 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| A549 | IC50 |
21.8 μg/mL
Compound: 1
|
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
|
[PMID: 18553923] |
| A549 | GI50 |
2.84 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human A549/ATCC cells by sulforhodamine B assay
Growth inhibition of human A549/ATCC cells by sulforhodamine B assay
|
[PMID: 23644211] |
| A549 | IC50 |
1.06 μM
Compound: 1, Lantadene A
|
Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay
Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay
|
[PMID: 24457265] |
| A549 | IC50 |
1.06 μmol
Compound: 1, Lantadene A
|
Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay
Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay
|
[PMID: 24457265] |
| A549 | IC50 |
2.84 μM
Compound: 1, Lantadene A
|
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
|
[PMID: 24457265] |
| A549 | IC50 |
2.84 μmol
Compound: 1, Lantadene A
|
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
|
[PMID: 24457265] |
| A549 | IC50 |
1.06 μM
Compound: 1, lantadene A
|
Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay
Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay
|
[PMID: 25027934] |
| A549 | IC50 |
2.84 μM
Compound: 1, lantadene A
|
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
|
[PMID: 25027934] |
| ACHN | GI50 |
4.94 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human ACHN cells by sulforhodamine B assay
Growth inhibition of human ACHN cells by sulforhodamine B assay
|
[PMID: 23644211] |
| BT-549 | GI50 |
4.73 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human BT549 cells by sulforhodamine B assay
Growth inhibition of human BT549 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| CAKI-1 | GI50 |
3.93 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human CAKI-1 cells by sulforhodamine B assay
Growth inhibition of human CAKI-1 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| CCRF-CEM | GI50 |
3.48 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
|
[PMID: 23644211] |
| COLO 205 | GI50 |
2.64 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human COLO205 cells by sulforhodamine B assay
Growth inhibition of human COLO205 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| DU-145 | GI50 |
5.92 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human DU145 cells by sulforhodamine B assay
Growth inhibition of human DU145 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HCC 2998 | GI50 |
3.33 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HCT-116 | IC50 |
41.8 μM
Compound: 11
|
Cytotoxicity against human HCT116 cells
Cytotoxicity against human HCT116 cells
|
[PMID: 19572612] |
| HCT-116 | GI50 |
3.62 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HCT116 cells by sulforhodamine B assay
Growth inhibition of human HCT116 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HCT-116 | IC50 |
13.4 μM
Compound: 1
|
Cytotoxicity against Homo sapiens (human) HCT116 cells assessed as growth inhibition after 48 hr by MTT assay
Cytotoxicity against Homo sapiens (human) HCT116 cells assessed as growth inhibition after 48 hr by MTT assay
|
10.1007/s00044-012-0354-x |
| HCT-15 | GI50 |
3.17 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HCT15 cells by sulforhodamine B assay
Growth inhibition of human HCT15 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HeLa | IC50 |
23.3 μg/mL
Compound: 1
|
Cytotoxicity against human HeLa cells after 48 hrs by MTT assay
Cytotoxicity against human HeLa cells after 48 hrs by MTT assay
|
[PMID: 18553923] |
| HL-60 | IC50 |
19.8 μg/mL
Compound: 1
|
Cytotoxicity against human HL60 cells after 48 hrs by MTT assay
Cytotoxicity against human HL60 cells after 48 hrs by MTT assay
|
[PMID: 18553923] |
| HL-60 | IC50 |
19.3 μM
Compound: 1
|
Cytotoxicity against Homo sapiens (human) HL60 cells assessed as growth inhibition after 48 hr by MTT assay
Cytotoxicity against Homo sapiens (human) HL60 cells assessed as growth inhibition after 48 hr by MTT assay
|
10.1007/s00044-012-0354-x |
| HL-60(TB) | GI50 |
1.87 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay
Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HOP-62 | GI50 |
2.06 x 10-5 M
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HOP62 cells by sulforhodamine B assay
Growth inhibition of human HOP62 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HOP-92 | GI50 |
1.19 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HOP92 cells by sulforhodamine B assay
Growth inhibition of human HOP92 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| Hs-578T | GI50 |
5.1 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human Hs 578T cells by sulforhodamine B assay
Growth inhibition of human Hs 578T cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HSC-2 | IC50 |
50.7 μM
Compound: 1
|
Cytotoxicity against Homo sapiens (human) HSC2 cells assessed as growth inhibition after 48 hr by MTT assay
Cytotoxicity against Homo sapiens (human) HSC2 cells assessed as growth inhibition after 48 hr by MTT assay
|
10.1007/s00044-012-0354-x |
| HT-29 | GI50 |
4.32 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human HT-29 cells by sulforhodamine B assay
Growth inhibition of human HT-29 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| IGROV-1 | GI50 |
6.75 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| K562 | GI50 |
4.72 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human K562 cells by sulforhodamine B assay
Growth inhibition of human K562 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| KB | IC50 |
15.8 μM
Compound: 11
|
Cytotoxicity against human KB cells
Cytotoxicity against human KB cells
|
[PMID: 19572612] |
| KM12 | GI50 |
3.52 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human KM12 cells by sulforhodamine B assay
Growth inhibition of human KM12 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| L1210 | IC50 |
16.3 μM
Compound: 11
|
Cytotoxicity against mouse L1210 cells
Cytotoxicity against mouse L1210 cells
|
[PMID: 19572612] |
| LOX IMVI | GI50 |
7.8 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human LOXIMVI cells by sulforhodamine B assay
Growth inhibition of human LOXIMVI cells by sulforhodamine B assay
|
[PMID: 23644211] |
| M14 | GI50 |
4.53 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human M14 cells by sulforhodamine B assay
Growth inhibition of human M14 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| Malme-3M | GI50 |
7.91 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human MALME-3M cells by sulforhodamine B assay
Growth inhibition of human MALME-3M cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MCF7 | IC50 |
44.7 μM
Compound: 11
|
Cytotoxicity against human MCF7 cells
Cytotoxicity against human MCF7 cells
|
[PMID: 19572612] |
| MCF7 | GI50 |
3.6 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human MCF7 cells by sulforhodamine B assay
Growth inhibition of human MCF7 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MCF7 | IC50 |
25.8 μM
Compound: 1
|
Cytotoxicity against Homo sapiens (human) MCF7 cells assessed as growth inhibition after 48 hr by MTT assay
Cytotoxicity against Homo sapiens (human) MCF7 cells assessed as growth inhibition after 48 hr by MTT assay
|
10.1007/s00044-012-0354-x |
| MDA-MB-231 | GI50 |
4.53 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MDA-MB-435 | GI50 |
5.24 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MDA-MB-468 | GI50 |
2.58 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MOLT-4 | GI50 |
3.34 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human MOLT4 cells by sulforhodamine B assay
Growth inhibition of human MOLT4 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI/ADR-RES | GI50 |
5.12 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay
Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H226 | GI50 |
4.71 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human NCI-H226 cells by sulforhodamine B assay
Growth inhibition of human NCI-H226 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H23 | GI50 |
4.55 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human NCI-H23 cells by sulforhodamine B assay
Growth inhibition of human NCI-H23 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H322M | GI50 |
3.94 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human NCI-H322M cells by sulforhodamine B assay
Growth inhibition of human NCI-H322M cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H460 | GI50 |
3.59 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H522 | GI50 |
3.25 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-3 | GI50 |
5.89 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human OVCAR3 cells by sulforhodamine B assay
Growth inhibition of human OVCAR3 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-4 | GI50 |
5.64 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human OVCAR4 cells by sulforhodamine B assay
Growth inhibition of human OVCAR4 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-5 | GI50 |
1.83 x 10-5 M
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-8 | GI50 |
4.97 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| PC-3 | GI50 |
2.53 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human PC3 cells by sulforhodamine B assay
Growth inhibition of human PC3 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| RPMI-8226 | GI50 |
2 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human RPMI8226 cells by sulforhodamine B assay
Growth inhibition of human RPMI8226 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| RXF 393 | GI50 |
2.41 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human RXF393 cells by sulforhodamine B assay
Growth inhibition of human RXF393 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SF-268 | GI50 |
5.96 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SF268 cells by sulforhodamine B assay
Growth inhibition of human SF268 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SF-295 | GI50 |
2.77 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SF295 cells by sulforhodamine B assay
Growth inhibition of human SF295 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SF-539 | GI50 |
6.51 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SF539 cells by sulforhodamine B assay
Growth inhibition of human SF539 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-MEL-2 | GI50 |
3.07 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-MEL-28 | GI50 |
1.28 x 10-5 M
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-MEL-5 | GI50 |
1.22 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-OV-3 | GI50 |
1.8 x 10-5 M
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SKOV3 cells by sulforhodamine B assay
Growth inhibition of human SKOV3 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SN12C | GI50 |
3.47 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SN12C cells by sulforhodamine B assay
Growth inhibition of human SN12C cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SNB-19 | GI50 |
4.67 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SNB19 cells by sulforhodamine B assay
Growth inhibition of human SNB19 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SNB-75 | GI50 |
1.42 x 10-5 M
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SNB75 cells by sulforhodamine B assay
Growth inhibition of human SNB75 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SR | GI50 |
3 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SR cells by sulforhodamine B assay
Growth inhibition of human SR cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SW-620 | GI50 |
4.48 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human SW620 cells by sulforhodamine B assay
Growth inhibition of human SW620 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| T47D | GI50 |
6.15 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human T47D cells by sulforhodamine B assay
Growth inhibition of human T47D cells by sulforhodamine B assay
|
[PMID: 23644211] |
| TK-10 | GI50 |
5.37 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human TK10 cells by sulforhodamine B assay
Growth inhibition of human TK10 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| U-251 | GI50 |
3.99 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human U251 cells by sulforhodamine B assay
Growth inhibition of human U251 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| UACC-257 | GI50 |
4.81 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human UACC257 cells by sulforhodamine B assay
Growth inhibition of human UACC257 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| UACC-62 | GI50 |
1.73 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human UACC62 cells by sulforhodamine B assay
Growth inhibition of human UACC62 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| UO-31 | GI50 |
3.44 μM
Compound: 1, Lantadene A, NCS:D-764049/1,
|
Growth inhibition of human UO31 cells by sulforhodamine B assay
Growth inhibition of human UO31 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| Vero | IC50 |
15 μM
Compound: 8
|
Cytotoxicity against african green monkey Vero cells
Cytotoxicity against african green monkey Vero cells
|
[PMID: 11170663] |
| Vero | IC50 |
>50 μM
Compound: 1
|
Cytotoxicity against Chlorocebus aethiops (African green monkey) Vero cells assessed as growth inhibition after 48 hr by MTT assay
Cytotoxicity against Chlorocebus aethiops (African green monkey) Vero cells assessed as growth inhibition after 48 hr by MTT assay
|
10.1007/s00044-012-0354-x |
Chemical Information
-
CAS No. 467-81-2
-
Appearance Solid
-
Molecular Weight 552.78
-
Formula C35H52O5
-
Color White to off-white
-
SMILES
CC1(C)C(CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])CC(C)(C)C[C@@H](OC(/C(C)=C\C)=O)[C@@](C(O)=O)5CC[C@](C)4[C@@](C)3CC[C@@]12[H])=O
-
Synonyms
Lantadene A
-
Structure Classification
-
Initial Source
-
Shipping
Room temperature in continental US; may vary elsewhere.
-
Storage
4°C, protect from light
* In solvent : -80°C, 6 months; -20°C, 1 month (protect from light)
Purity & Documentation
-
Data Sheet (269 KB)
-
SDS (252 KB)
- English - EN (252 KB)
- Français - FR (252 KB)
- Deutsch - DE (252 KB)
- Norwegian - NO (252 KB)
- Español - ES (252 KB)
- Swedish - SV (252 KB)
- Italian - IT (252 KB)
- Korean - KR (252 KB)
- Portuguese - PT (252 KB)
-
Handling Instructions (2659 KB)
References
Calculators
Concentration (start) × Volume (start) = Concentration (final) × Volume (final)