2756855-45-3
Chemical Structure
Lp-PLA2-IN-10
- CAS No.: 2756855-45-3
- Formula:C21H15F5N4O4
- Molecular Weight:482.36
IUPAC Name: 6-((3,5-difluoro-4-((2-(trifluoromethyl)pyridin-4-yl)oxy)benzyl)oxy)-1,2,3,4-tetrahydro-8H-5-oxa-2a,7,8a-triazaacenaphthylen-8-one
InChIKey: XTSLPMYBDSIBMU-UHFFFAOYSA-N
SMILES: O=C1N=C(C2=C3N(CCN13)CCO2)OCC4=CC(F)=C(C(F)=C4)OC5=CC(C(F)(F)F)=NC=C5
Biological Activity: Lp-PLA2-IN-10 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-10 has the potential for the research of neurodegenerative-related diseases such as Alzheimer's disease (AD), glaucoma, age-related macular degeneration (AMD), or cardiovascular diseases including atherosclerosis (extracted from patent WO2022001881A1, compound 4)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lp-PLA2-IN-10 | Lp-PLA2-IN-10 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-10 has the potential for the research of neurodegenerative-related diseases such as Alzheimer's disease (AD), glaucoma, age-related macular degeneration (AMD), or cardiovascular diseases including atherosclerosis (extracted from patent WO2022001881A1, compound 4). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||