36700-45-5
![[8]-Shogaol Chemical Structure](http://file.medchemexpress.cn/product_pic/hy-n2435.gif "[8]-Shogaol Chemical Structure")
Chemical Structure
[8]-Shogaol
- CAS No.: 36700-45-5
- Formula:C19H28O3
- Molecular Weight:304.42
IUPAC Name: (E)-1-(4-hydroxy-3-methoxyphenyl)dodec-4-en-3-one
InChIKey: LGZSMXJRMTYABD-MDZDMXLPSA-N
SMILES: CCCCCCC/C=C/C(CCC1=CC=C(O)C(OC)=C1)=O
Biological Activity: [8]-Shogaol, a kind of stimulating compound in ginger, has antiplatelet (IC50=5 μM), anti-cancer and anti-inflammatory activity. [8]-Shogaol inhibited COX-2 (IC50=17.5 μM), which led to the decline of human leukemia cells. 8-Shogaol Selective direction TAK1 sum TAK1-TAB1 (IC50=5 μM), suppress IKK, Akt sum MAPK signal pathway, and reverse synovitis synovial sum Air dampness (RA).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
[8]-Shogaol | 99.85% | -Shogaol, a kind of stimulating compound in ginger, has antiplatelet (IC50=5 μM), anti-cancer and anti-inflammatory activity. -Shogaol inhibited COX-2 (IC50=17.5 μM), which led to the decline of human leukemia cells. 8-Shogaol Selective direction TAK1 sum TAK1-TAB1 (IC50=5 μM), suppress IKK, Akt sum MAPK signal pathway, and reverse synovitis synovial sum Air dampness (RA). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
[8]-Shogaol (Standard) | ≥98% | -Shogaol (Standard) is the analytical standard of -Shogaol. This product is intended for research and analytical applications. -Shogaol, a kind of stimulating compound in ginger, has antiplatelet (IC50=5 μM), anti-cancer and anti-inflammatory activity. -Shogaol inhibited COX-2 (IC50=17.5 μM), which led to the decline of human leukemia cells. 8-Shogaol Selective direction TAK1 sum TAK1-TAB1 (IC50=5 μM), suppress IKK, Akt sum MAPK signal pathway, and reverse synovitis synovial sum Air dampness (RA). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
