3791-76-2
Chemical Structure
Dihydroflavokawin B
- CAS No.: 3791-76-2
- Formula:C17H18O4
- Molecular Weight:286.33
IUPAC Name: 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one
InChIKey: JAJFQMZJIQDRSX-UHFFFAOYSA-N
SMILES: O=C(C=1C(O)=CC(OC)=CC1OC)CCC=2C=CC=CC2
Biological Activity: Dihydroflavokawin B is a selective COX-1 inhibitor with an IC50 of 1.22 μM. Dihydroflavokawin B weakly inhibits COX-2 and 5-LOX. Dihydroflavokawin B inhibits promastigote forms of Leishmania panamensis and Leishmania braziliensis. Dihydroflavokawin B inhibits rabbit platelet aggregation induced by Arachidonic acid, platelet activating factor, and adenosine diphosphate. Dihydroflavokawin B exhibits in vitro anti-inflammatory activity. Dihydroflavokawin B can be used for the research of leishmaniasis[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dihydroflavokawin B | Dihydroflavokawin B is a selective COX-1 inhibitor with an IC50 of 1.22 μM. Dihydroflavokawin B weakly inhibits COX-2 and 5-LOX. Dihydroflavokawin B inhibits promastigote forms of Leishmania panamensis and Leishmania braziliensis. Dihydroflavokawin B inhibits rabbit platelet aggregation induced by Arachidonic acid, platelet activating factor, and adenosine diphosphate. Dihydroflavokawin B exhibits in vitro anti-inflammatory activity. Dihydroflavokawin B can be used for the research of leishmaniasis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Sánchez-Suárez J, et al. Leishmanicidal and cytotoxic activities of extracts and naturally-occurring compounds from two Lauraceae species. Nat Prod Commun. 2011;6(2):231-234. [Content Brief]
- [2]. Coy-Barrera ED, et al. In vitro anti-inflammatory effects of naturally-occurring compounds from two Lauraceae plants. An Acad Bras Cienc. 2011;83(4):1397-1402. [Content Brief]