82938-07-6
82938-07-6
Chemical Structure
Progesterone-13C2
Synonym(s): Pregn-4-ene-3,20-dione-13C2
- CAS No.: 82938-07-6
- Formula:C1913C2H30O2
- Molecular Weight:316.45
IUPAC Name: (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[i]phenanthren-3-one-3,4-13C2
InChIKey: RJKFOVLPORLFTN-PIWOXAIRSA-N
SMILES: CC([C@H]1CC[C@@]2([H])[C@]3([H])CCC4=[13CH][13C](CC[C@]4(C)[C@@]3([H])CC[C@]12C)=O)=O
Biological Activity: Progesterone-13C2 is the 13C-labeled Progesterone. Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Progesterone-13C2 | 99.7% | Progesterone-13C2 is the 13C-labeled Progesterone. Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Progesterone (Standard) | 99.20% | Progesterone (Standard) is the analytical standard of Progesterone. This product is intended for research and analytical applications. Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Progesterone-d9 | 99.93% | Progesterone-d9 is the deuterium labeled Progesterone. Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Progesterone-13C3 | 99.60% | Progesterone-13C3 is the 13C-labeled Progesterone. Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Progesterone-13C5 | Progesterone-13C5 is the 13C-labeled Progesterone. Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Progesterone | 99.79% | Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Structural Analogs
-
Similarity Score 1.00
HY-Z9018Progesterone impurity 8 -
Similarity Score 0.89
HY-113414SDeoxycorticosterone-d8 -
Similarity Score 0.88
HY-108409RProgesterone carboxylic acid (Standard) -
Similarity Score 0.87
HY-113414RDeoxycorticosterone (Standard) -
Similarity Score 0.86
HY-Z8249Progesterone impurity 2 -
Similarity Score 0.84
HY-17649EIDD-036 -
Similarity Score 0.84
HY-131547Org OD 02-0 -
Similarity Score 0.83
HY-B0891S17α-Hydroxyprogesterone-d8 -
Similarity Score 0.83
HY-Z8247Progesterone impurity 5 -
Explore the MedChemAI to find more analogs
