HOE 689
HOE 689 (Ramnodigin) is an analog of Digitoxin (HY-B1357). HOE 689 exhibits cytotoxicity to lung cancer cells and induces apoptosis in cancer cell NCI-H460 with an IC50 of 52 nM.
Nur für Forschungszwecke. Wir verkaufen nicht an Patienten.
- CAS. Nr.: 33156-28-4
- Formel: C29H44O6
- Molecular Weight:488.66
-
Speicherung:
Please store the product under the recommended conditions in the Certificate of Analysis.
Biologische Aktivität
|
Cell Line
|
Type | Value | Description | References |
|---|---|---|---|---|
| 786-0 | GI50 |
0.00621 μM
Compound: 7, mono-7
|
Cytotoxicity against human 786-0 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human 786-0 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| 786-0 | GI50 |
6.21 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human 786-0 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human 786-0 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| A498 | GI50 |
0.0207 μM
Compound: 7, mono-7
|
Cytotoxicity against human A498 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human A498 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| A498 | GI50 |
20.7 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human A498 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human A498 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| A549 | GI50 |
0.00156 μM
Compound: 7, mono-7
|
Cytotoxicity against human A549 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human A549 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| A549 | GI50 |
1.56 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human A549/ATCC cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human A549/ATCC cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| ACHN | GI50 |
0.00431 μM
Compound: 7, mono-7
|
Cytotoxicity against human ACHN cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human ACHN cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| ACHN | GI50 |
4.31 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human ACHN cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human ACHN cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| BT-549 | GI50 |
2.41 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human BT549 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human BT549 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| CAKI-1 | GI50 |
3.32 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human Caki1 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human Caki1 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| CCRF-CEM | GI50 |
8.49 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human CCRF-CEM cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human CCRF-CEM cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| COLO 205 | GI50 |
0.0296 μM
Compound: 7, mono-7
|
Cytotoxicity against human COLO205 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human COLO205 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| COLO 205 | GI50 |
29.6 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human COLO205 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human COLO205 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| DU-145 | GI50 |
0.00345 μM
Compound: 7, mono-7
|
Cytotoxicity against human DU145 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human DU145 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| DU-145 | GI50 |
3.45 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human DU145 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human DU145 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| EKVX | GI50 |
0.00513 μM
Compound: 7, mono-7
|
Cytotoxicity against human EKVX cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human EKVX cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| EKVX | GI50 |
5.13 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human EKVX cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human EKVX cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| HCC 2998 | GI50 |
16.5 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human HCC2998 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HCC2998 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| HCT-15 | GI50 |
0.0205 μM
Compound: 7, mono-7
|
Cytotoxicity against human HCT15 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HCT15 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| HCT-15 | GI50 |
20.5 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human HCT15 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HCT15 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| HFF | CC50 |
0.7 μM
Compound: 6, alpha-L-Amip-Dig
|
Cytotoxicity against HFF assessed as inhibition of cell viability after 3 days by MTT assay
Cytotoxicity against HFF assessed as inhibition of cell viability after 3 days by MTT assay
|
[PMID: 24900847] |
| HFF | CC50 |
4 μM
Compound: 6, alpha-L-Amip-Dig
|
Cytotoxicity against HFF assessed as inhibition of cell viability after 3 days by trypan blue exclusion assay
Cytotoxicity against HFF assessed as inhibition of cell viability after 3 days by trypan blue exclusion assay
|
[PMID: 24900847] |
| HL-60(TB) | GI50 |
2.96 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human HL-60(TB) cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HL-60(TB) cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| HOP-62 | GI50 |
0.00855 μM
Compound: 7, mono-7
|
Cytotoxicity against human HOP62 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HOP62 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| HOP-62 | GI50 |
8.55 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human HOP62 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HOP62 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| HOP-92 | GI50 |
0.0113 μM
Compound: 7, mono-7
|
Cytotoxicity against human HOP92 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HOP92 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| HOP-92 | GI50 |
11.3 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human HOP92 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HOP92 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| Hs-578T | GI50 |
0.00457 μM
Compound: 7, mono-7
|
Cytotoxicity against human Hs578T cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human Hs578T cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| Hs-578T | GI50 |
4.57 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human Hs578T cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human Hs578T cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| HT-29 | GI50 |
0.0119 μM
Compound: 7, mono-7
|
Cytotoxicity against human HT-29 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HT-29 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| HT-29 | GI50 |
11.9 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human HT-29 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human HT-29 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| IGROV-1 | GI50 |
5.23 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human IGROV1 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human IGROV1 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| K562 | GI50 |
19.5 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human K562 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human K562 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| KM12 | GI50 |
0.0324 μM
Compound: 7, mono-7
|
Cytotoxicity against human KM12 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human KM12 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| KM12 | GI50 |
32.4 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human KM12 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human KM12 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| LOX IMVI | GI50 |
0.0118 μM
Compound: 7, mono-7
|
Cytotoxicity against human LOXIMVI cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human LOXIMVI cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| LOX IMVI | GI50 |
11.8 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human LOXIMVI cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human LOXIMVI cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| M14 | GI50 |
0.0193 μM
Compound: 7, mono-7
|
Cytotoxicity against human M14 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human M14 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| M14 | GI50 |
19.3 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human M14 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human M14 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| Malme-3M | GI50 |
0.0183 μM
Compound: 7, mono-7
|
Cytotoxicity against human MALME-3M cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MALME-3M cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| Malme-3M | GI50 |
18.3 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human MALME-3M cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MALME-3M cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| MCF7 | GI50 |
0.00589 μM
Compound: 7, mono-7
|
Cytotoxicity against human MCF7 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MCF7 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| MCF7 | GI50 |
5.89 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human MCF7 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MCF7 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| MDA-MB-231 | GI50 |
0.0339 μM
Compound: 7, mono-7
|
Cytotoxicity against human MDA-MB-231 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MDA-MB-231 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| MDA-MB-231 | GI50 |
33.9 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human MDA-MB-231 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MDA-MB-231 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| MDA-MB-435 | GI50 |
0.0277 μM
Compound: 7, mono-7
|
Cytotoxicity against human MDA-MB-435 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MDA-MB-435 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| MDA-MB-435 | GI50 |
21 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human MDA-MB-435 breast cancer cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MDA-MB-435 breast cancer cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| MDA-MB-435 | GI50 |
27.7 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human MDA-MB-435 melanoma cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MDA-MB-435 melanoma cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| MOLT-4 | GI50 |
0.00257 μM
Compound: 7, mono-7
|
Cytotoxicity against human MOLT4 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MOLT4 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| MOLT-4 | GI50 |
2.57 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human MOLT4 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human MOLT4 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| NCI/ADR-RES | GI50 |
4.12 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI/ADR-RES cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI/ADR-RES cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| NCI-H226 | GI50 |
0.0193 μM
Compound: 7, mono-7
|
Cytotoxicity against human NCI-H226 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H226 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| NCI-H226 | GI50 |
19.3 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI-H226 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H226 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| NCI-H23 | GI50 |
0.00413 μM
Compound: 7, mono-7
|
Cytotoxicity against human NCI-H23 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H23 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| NCI-H23 | GI50 |
4.13 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI-H23 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H23 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| NCI-H322M | GI50 |
0.00778 μM
Compound: 7, mono-7
|
Cytotoxicity against human NCI-H322M cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H322M cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| NCI-H322M | GI50 |
7.78 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI-H322M cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H322M cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| NCI-H460 | GI50 |
0.00383 μM
Compound: 7, mono-7
|
Cytotoxicity against human NCI-H460 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H460 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| NCI-H460 | GI50 |
1.927 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI-H460 cells assessed as cell viability after 48 hrs by MTT assay
Cytotoxicity against human NCI-H460 cells assessed as cell viability after 48 hrs by MTT assay
|
[PMID: 21572583] |
| NCI-H460 | GI50 |
2 nM
Compound: 9, C5'-Me 9
|
Growth inhibition of human NCI-H460 cells after 48 hrs by MTT assay
Growth inhibition of human NCI-H460 cells after 48 hrs by MTT assay
|
[PMID: 21572583] |
| NCI-H460 | GI50 |
2.2 nM
Compound: 7,alpha-L-amicetose
|
Growth inhibition of human NCI-H460 cells after 48 hrs by MTT assay
Growth inhibition of human NCI-H460 cells after 48 hrs by MTT assay
|
[PMID: 21643465] |
| NCI-H460 | GI50 |
3.83 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI-H460 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H460 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| NCI-H460 | IC50 |
47.98 nM
Compound: 7, mono-7
|
Cytotoxicity against human NCI-H460 cell assessed as cell death after 12 hrs by Hoechst 33342/propidium iodide staining based fluorescence microscopy
Cytotoxicity against human NCI-H460 cell assessed as cell death after 12 hrs by Hoechst 33342/propidium iodide staining based fluorescence microscopy
|
[PMID: 21660118] |
| NCI-H460 | IC50 |
51.73 nM
Compound: 9, C5'-Me 9
|
Induction of apoptosis in human NCI-H460 cells in serum free medium after 12 hrs by Hoechst 33342/propidium iodide staining based fluorescence microscopy
Induction of apoptosis in human NCI-H460 cells in serum free medium after 12 hrs by Hoechst 33342/propidium iodide staining based fluorescence microscopy
|
[PMID: 21572583] |
| NCI-H460 | IC50 |
52 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity in human NCI-H460 cells in serum free medium at 50 nM after 12 hrs by Hoechst 33342/propidium iodide staining based fluorescence microscopy
Cytotoxicity in human NCI-H460 cells in serum free medium at 50 nM after 12 hrs by Hoechst 33342/propidium iodide staining based fluorescence microscopy
|
[PMID: 21572583] |
| NCI-H460 | IC50 |
55.7 nM
Compound: 7,alpha-L-amicetose
|
Cytotoxicity against human NCI-H460 cells assessed as cell death at 50 nM after 12 hrs by Hoechst-33342 staining and propidium iodide staining
Cytotoxicity against human NCI-H460 cells assessed as cell death at 50 nM after 12 hrs by Hoechst-33342 staining and propidium iodide staining
|
[PMID: 21643465] |
| NCI-H522 | GI50 |
0.00938 μM
Compound: 7, mono-7
|
Cytotoxicity against human NCI-H522 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H522 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| NCI-H522 | GI50 |
9.38 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human NCI-H522 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human NCI-H522 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| OVCAR-3 | GI50 |
0.00494 μM
Compound: 7, mono-7
|
Cytotoxicity against human OVCAR3 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR3 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| OVCAR-3 | GI50 |
4.94 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human OVCAR3 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR3 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| OVCAR-4 | GI50 |
0.0189 μM
Compound: 7, mono-7
|
Cytotoxicity against human OVCAR4 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR4 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| OVCAR-4 | GI50 |
18.9 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human OVCAR4 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR4 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| OVCAR-5 | GI50 |
17.4 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human OVCAR5 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR5 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| OVCAR-8 | GI50 |
0.0025 μM
Compound: 7, mono-7
|
Cytotoxicity against human OVCAR8 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR8 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| OVCAR-8 | GI50 |
2.5 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human OVCAR8 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human OVCAR8 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| PC-3 | GI50 |
0.00955 μM
Compound: 7, mono-7
|
Cytotoxicity against human PC3 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human PC3 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| PC-3 | GI50 |
9.55 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human PC3 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human PC3 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| RPMI-8226 | GI50 |
0.0235 μM
Compound: 7, mono-7
|
Cytotoxicity against human RPMI8226 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human RPMI8226 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| RPMI-8226 | GI50 |
23.5 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human RPMI8226 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human RPMI8226 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| RXF 393 | GI50 |
1.22 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human RXF393 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human RXF393 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SF-268 | GI50 |
0.00428 μM
Compound: 7, mono-7
|
Cytotoxicity against human SF268 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SF268 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SF-268 | GI50 |
4.28 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SF268 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SF268 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SF-295 | GI50 |
0.0104 μM
Compound: 7, mono-7
|
Cytotoxicity against human SF295 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SF295 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SF-295 | GI50 |
10.4 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SF295 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SF295 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SF-539 | GI50 |
0.0078 μM
Compound: 7, mono-7
|
Cytotoxicity against human SF539 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SF539 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SF-539 | GI50 |
7.8 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SF539 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SF539 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SK-MEL-28 | GI50 |
0.0231 μM
Compound: 7, mono-7
|
Cytotoxicity against human SK-MEL-28 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SK-MEL-28 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SK-MEL-28 | GI50 |
23.1 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SK-MEL-28 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SK-MEL-28 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SK-MEL-5 | GI50 |
0.00544 μM
Compound: 7, mono-7
|
Cytotoxicity against human SK-MEL-5 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SK-MEL-5 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SK-MEL-5 | GI50 |
5.44 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SK-MEL-5 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SK-MEL-5 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SK-OV-3 | GI50 |
0.0222 μM
Compound: 7, mono-7
|
Cytotoxicity against human SKOV3 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SKOV3 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SK-OV-3 | GI50 |
22.2 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SKOV3 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SKOV3 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SN12C | GI50 |
0.00361 μM
Compound: 7, mono-7
|
Cytotoxicity against human SN12C cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SN12C cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SN12C | GI50 |
3.61 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SN12C cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SN12C cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SNB-19 | GI50 |
0.0375 μM
Compound: 7, mono-7
|
Cytotoxicity against human SNB19 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SNB19 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SNB-19 | GI50 |
37.5 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SNB19 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SNB19 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SNB-75 | GI50 |
0.0149 μM
Compound: 7, mono-7
|
Cytotoxicity against human SNB75 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SNB75 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SNB-75 | GI50 |
14.9 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SNB75 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SNB75 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SR | GI50 |
0.00225 μM
Compound: 7, mono-7
|
Cytotoxicity against human SR cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SR cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SR | GI50 |
2.25 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SR cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SR cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| SW-620 | GI50 |
0.0111 μM
Compound: 7, mono-7
|
Cytotoxicity against human SW620 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SW620 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| SW-620 | GI50 |
11.1 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human SW620 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human SW620 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| T47D | GI50 |
0.021 μM
Compound: 7, mono-7
|
Cytotoxicity against human T47D cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human T47D cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| T47D | GI50 |
20.6 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human T47D cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human T47D cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| TK-10 | GI50 |
0.00375 μM
Compound: 7, mono-7
|
Cytotoxicity against human TK10 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human TK10 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| TK-10 | GI50 |
3.75 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human TK10 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human TK10 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| U-251 | GI50 |
0.00257 μM
Compound: 7, mono-7
|
Cytotoxicity against human U251 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human U251 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| U-251 | GI50 |
12.7 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human U251 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human U251 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| UACC-257 | GI50 |
0.0196 μM
Compound: 7, mono-7
|
Cytotoxicity against human UACC257 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human UACC257 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| UACC-257 | GI50 |
19.6 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human UACC257 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human UACC257 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| UACC-62 | GI50 |
0.0127 μM
Compound: 7, mono-7
|
Cytotoxicity against human UACC62 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human UACC62 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| UACC-62 | GI50 |
12.7 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human UACC62 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human UACC62 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
| UO-31 | GI50 |
0.00515 μM
Compound: 7, mono-7
|
Cytotoxicity against human UO31 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human UO31 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21660118] |
| UO-31 | GI50 |
5.15 nM
Compound: 9, C5'-Me 9
|
Cytotoxicity against human UO31 cells after 48 hrs by sulforhodamine B assay
Cytotoxicity against human UO31 cells after 48 hrs by sulforhodamine B assay
|
[PMID: 21572583] |
Chemical Information
-
CAS. Nr. 33156-28-4
-
Molecular Weight 488.66
-
Formel C29H44O6
-
SMILES
O[C@@]12[C@@]3([H])[C@@](CC[C@@]1([C@@H](C(CO4)=CC4=O)CC2)C)([H])[C@@]5([C@](C[C@H](CC5)O[C@@H]6O[C@H]([C@@H](CC6)O)C)([H])CC3)C
-
Synonyms
Ramnodigin
-
Versand
Room temperature in continental US; may vary elsewhere.
-
Speicherung
Please store the product under the recommended conditions in the Certificate of Analysis.
Reinheit & Dokumentation
Verweise
Calculators
Konzentration (Stammlösung) × Volumen (Stammlösung) = Konzentration (Ziellösung) × Volumen (Ziellösung)