552-16-9
552-16-9
Chemical Structure
2-Nitrobenzoic acid
- CAS 番号: 552-16-9
- Formula:C7H5NO4
- Molecular Weight:167.12
IUPAC Name: 2-nitrobenzoic acid
InChIKey: SLAMLWHELXOEJZ-UHFFFAOYSA-N
SMILES: O=C(O)C1=CC=CC=C1[N+]([O-])=O
Biological Activity: 2-Nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| 製品番号 | 製品名 | 純度 | 製品説明 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-Nitrobenzoic acid | 99.96% | 2-Nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Bromo-3-nitrobenzoic acid | 98.81% | 2-Bromo-3-nitrobenzoic acid is a brominated nitrobenzoic acid and also a starting material for the synthesis of 3-substituted-5-nitroisocoumarins. 3-Substituted-5-nitroisocoumarins are key intermediates of PARP inhibitor analogs. 2-Bromo-3-nitrobenzoic acid serves as an easily accessible precursor for the synthesis of 7-nitrobenzo[b]thiophene and 7-nitro-1,2-benzisothiazole derivatives. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Bromo-2-nitrobenzoic acid | 98.0% | 4-Bromo-2-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Bromo-2-nitrobenzoic acid | 5-Bromo-2-nitrobenzoic acid is a building block in the chemical synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Methyl-2-nitrobenzoic acid | 99.83% | 2-Nitro-5-methylbenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Nitrobenzamide | 99.16% | 2-Nitrobenzamide is a drug intermediate for synthesis of various active compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Nitrosalicylic acid (Standard) | ≥98% | 3-Nitrosalicylic acid (Standard) is the analytical standard of 3-Nitrosalicylic acid. This product is intended for research and analytical applications. 2-Hydroxy-3-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid (Standard) | ≥98% | 4-Nitrobenzoic acid (Standard) is the analytical standard of 4-Nitrobenzoic acid (HY-Y0607). This product is intended for research and analytical applications. 4-Nitrobenzoic acid is an oxidoreduction mediator and an electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from the reduced glucose oxidase and transfers them to the electrode to promote the glucose oxidation reaction, while minimizing the formation of protonated amine groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Mesalazine impurity 2 | 99.66% | Mesalazine impurity 2 is an impurity of Mesalazine (HY-15027). 5-Aminosalicylic acid (Mesalamine) acts as a specific PPARγ agonist and also inhibits p21-activated kinase 1 (PAK1) and NF-κB. 5-Aminosalicylic acid can inhibit the activity of osteopontin (OPN). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Nitrobenzoic acid | 99.91% | 3-Nitrobenzoic acid (m-Carboxynitrobenzene; m-Nitrobenzenecarboxylic acid; m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi. 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Amino-3-nitrobenzoic acid | 2-Amino-3-nitrobenzoic acid is a peroxide with antiviral activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
