60-25-3
Chemical Structure
Hexamethonium chloride
Synonym(s): Hexone chloride
- CAS No.: 60-25-3
- Formula:C12H30Cl2N2
- Molecular Weight:273.29
IUPAC Name: N1,N1,N1,N6,N6,N6-hexamethylhexane-1,6-diaminium chloride
InChIKey: PYIHTIJNCRKDBV-UHFFFAOYSA-L
SMILES: C[N+](C)(C)CCCCCC[N+](C)(C)C.[Cl-].[Cl-]
Biological Activity: Hexamethonium Chloride Dihydrate is a synthetic organic compound commonly used as a ganglion blocking agent, which means it blocks the transmission of nerve impulses between ganglion cells in the autonomic nervous system. Hexamethonium Chloride Dihydrate is used in various medical applications such as lowering blood pressure or inhibiting certain types of neuropathic pain. It works by inhibiting the release of acetylcholine, a neurotransmitter that plays a key role in regulating many bodily functions.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Hexamethonium chloride | 99.49% | Hexamethonium Chloride Dihydrate is a synthetic organic compound commonly used as a ganglion blocking agent, which means it blocks the transmission of nerve impulses between ganglion cells in the autonomic nervous system. Hexamethonium Chloride Dihydrate is used in various medical applications such as lowering blood pressure or inhibiting certain types of neuropathic pain. It works by inhibiting the release of acetylcholine, a neurotransmitter that plays a key role in regulating many bodily functions. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
