83286-58-2
83286-58-2
Chemical Structure
Pencycuron-d5
- CAS No.: 83286-58-2
- Formula:C19H16D5ClN2O
- Molecular Weight:333.87
IUPAC Name: 1-(4-chlorobenzyl)-1-cyclopentyl-3-(phenyl-d5)urea
InChIKey: OGYFATSSENRIKG-FSTBWYLISA-N
SMILES: ClC(C=C1)=CC=C1CN(C2CCCC2)C(NC3=C([2H])C([2H])=C([2H])C([2H])=C3[2H])=O
Biological Activity: Pencycuron-d5 is the deuterium labeled Pencycuron (HY-B2048). Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pencycuron-d5 | 99.9% | Pencycuron-d5 is the deuterium labeled Pencycuron (HY-B2048). Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pencycuron (Standard) | ≥98% | Pencycuron (Standard) is the analytical standard of Pencycuron. This product is intended for research and analytical applications. Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pencycuron | Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
U-48520 | U-48520 is an agonist for μ-opioid receptor with EC50 of 1561 nM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
GW9662-d5 | GW9662-d5 is the deuterium labeled GW9662. GW9662 is a potent and selective PPARγ antagonist with an IC50 of 3.3 nM, showing 10 and 1000-fold selectivity over PPARα and PPARδ, respectively. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
FPS-ZM1 | 99.87% | FPS-ZM1 is a high-affinity and BBB-permeable RAGE inhibitor with a Ki of 25 nM. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Triclocarban-d4 | 98.09% | Triclocarban-d4 is the deuterium labeled Triclocarban. Triclocarban (3,4,4′-Trichlorocarbanilide), a broad spectrum antibacterial compound, is widely used in a broad range of applications such as the production of soaps, skin creams, toothpastes and deodorants. Triclocarban is a potential endocrine-disrupting chemical with the capacity to modulate androgen and estrogen activities as well as other hormone-mediated biological processes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Forchlorfenuron-d5 | Forchlorfenuron-d5 is the deuterium labeled Forchlorfenuron. Forchlorfenuron is plant growth regulator and cytokinin; can be used to increase fruit size of fruits, such as kiwi fruit and grapes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Diflubenzuron-d4 | 99.31% | Diflubenzuron-d4 is the deuterium labeled Diflubenzuron. Diflubenzuron is an insecticide with larvicidal and ovicidal activities. Diflubenzuron can inhibit the synthesis of chitin in insects, affect insect molting and lead to the death of insects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,3-Diphenylurea-d10 | 99% | 1,3-Diphenylurea-d10 is the deuterium labeled 1,3-Diphenylurea. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyl yellow-d5 | 99% | Methyl yellow-d5 is the deuterium labeled Methyl yellow. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-([1,1'-Biphenyl]-4-yl)acetamide-d5 | N-([1,1'-Biphenyl]-4-yl)acetamide-d5 (4-Acetylaminobiphenyl-d5) is the deuterium labeled N-([1,1'-Biphenyl]-4-yl)acetamide (HY-W014335). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
