95809-78-2
95809-78-2
Chemical Structure
Devimistat
Synonym(s): CPI-613
- CAS No.: 95809-78-2
- Formula:C22H28O2S2
- Molecular Weight:388.59
IUPAC Name: 6,8-bis(benzylthio)octanoic acid
InChIKey: ZYRLHJIMTROTBO-UHFFFAOYSA-N
SMILES: O=C(O)CCCCC(SCC1=CC=CC=C1)CCSCC2=CC=CC=C2
Biological Activity: Devimistat is a mitochondrial metabolism inhibitor. Devimistat is a lipoic acid antagonist that abrogates mitochondrial energy metabolism to induce apoptosis in various cancer cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Devimistat | 99.57% | Devimistat is a mitochondrial metabolism inhibitor. Devimistat is a lipoic acid antagonist that abrogates mitochondrial energy metabolism to induce apoptosis in various cancer cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Devimistat (Standard) | ≥98% | Devimistat (Standard) is the analytical standard of Devimistat (HY-15453). This product is intended for research and analytical applications. Devimistat is a mitochondrial metabolism inhibitor. Devimistat is a lipoic acid antagonist that abrogates mitochondrial energy metabolism to induce apoptosis in various cancer cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Devimistat-d10 | 99.93% | Devimistat-d10 is the deuterium-labeled Devimistat (HY-15453). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
trans-Stilbene-d10 | trans-Stilbene-d10 ((E)-Stilbene-d10) is the deuterium labeled trans-Stilbene (HY-128793). trans-Stilbene ((E)-Stilbene) is used in the manufacturing of dye lasers, optical brighteners, non-steroidal synthetic estrogens. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dibenzyl trisulfide | 98.24% | Dibenzyl trisulfide (DTS) is an active ingredient that can be isolated from Petiveria alliacea L.. Dibenzyl trisulfide inhibits cell proliferation and migration. Dibenzyl trisulfide decreased the mRNA and protein expression of BAK-1 and LTA. Dibenzyl trisulfide induces lysosomal membrane permeabilization and cathepsin B release. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Phenylbutyric acid-d5 | 4-Phenylbutyric acid-d5 is the deuterium labeled 4-Phenylbutyric acid. 4-Phenylbutyric acid (4-PBA) is an inhibitor of HDAC and endoplasmic reticulum (ER) stress, used in cancer and infection research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Yashabushidiol A | Yashabushidiol A is a natural product that can be isolated from Alnus sieboldiana. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Yashabushidiol B | Yashabushidiol B is a natural product. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Diphenylmethanol-d10 | Diphenylmethanol-d10 (Benzhydrol-d10) is the deuterium labeled Benzhydrol (HY-W004059). Diphenylmethanol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dibenzyl disulfide | 99.94% | Dibenzyl disulfide is an endogenous metabolite. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-[(Diphenylmethyl)thio]acetamide (Standard) | ≥98% | 2-[(Diphenylmethyl)thio]acetamide (Standard) is the analytical standard of 2-[(Diphenylmethyl)thio]acetamide. This product is intended for research and analytical applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,2-Diphenylethyne-d10 | 1,2-Diphenylethyne-d10 is the deuterium labeled 1,2-Diphenylethyne. 1,2-Diphenylethyne is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Acetyl-S-benzyl-L-cysteine-d5 | N-Acetyl-S-benzyl-L-cysteine-d5 is the deuterium labeled N-Acetyl-S-benzyl-L-cysteine. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
10-(Benzyloxy)-10-oxodecanoic acid | 10-(Benzyloxy)-10-oxodecanoic acid is a PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
12-(Benzyloxy)-12-oxododecanoic acid | 12-(Benzyloxy)-12-oxododecanoic acid is a PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-(Tritylthio)hexanoic acid | 6-(Tritylthio)hexanoic acid is a linker with a Tst group and a terminal carboxylic acid. The Tst group can be deprotected under acidic conditions to obtain the free thiol which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dibenzyl adipate | Dibenzyl adipate is a PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-(Benzhydrylsulfinyl)acetic acid-d10 | 2-(Benzhydrylsulfinyl)acetic acid-d10 (Modafinil acid-d10) is the deuterium labeled 2-(Benzhydrylsulfinyl)acetic acid (HY-W103882). 2-Benzhydrylsulfinylacetic acid (Modafinil acid) is the metabolite of modafinil. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-[(Diphenylmethyl)thio]acetic Acid-d10 | 2-[(Diphenylmethyl)thio]acetic Acid-d10 is the deuterium labeled 2-(Benzhydrylthio)acetic acid (HY-Y0092). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Benzophenone-d10 | 99.92% | Benzophenone-d10 is the deuterium labeled Benzophenone (HY-Y0546). Benzophenone is an endogenous metabolite. Benzophenone is a photosensitizer, that absorbs UV light, transfers its energy to DNA, and triggers DNA damage. Benzophenone can be used as the fragrance enhancer, ultraviolet curing agent, additive in plastics, or the flavor ingredient. Benzophenone can also be used in the manufacturing of insecticides, agricultural chemicals, hypnotics, antihistamines, and other pharmaceuticals. Benzophenone exhibits certain carcinogenicity in mouse/rat models under long term exposure. Benzophenone exhibits estrogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dibenzylamine-d10 | 98.20% | Dibenzylamine-d10 (Bisbenzylamine-d10) is the deuterium labeled Dibenzylamine. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
