2488892-07-3
Chemical Structure
TMX-2138
- CAS No.: 2488892-07-3
- Formula:C40H43BrFN9O11S
- Molecular Weight:956.79
InChIKey: FCFITSHNFYGDJJ-UHFFFAOYSA-N
SMILES: O=C(C1=C(NC2=NC(NC3=CC=C(S(=O)(NCCOCCOCCOCCOCCNC4=CC=CC(C(N5C6C(NC(CC6)=O)=O)=O)=C4C5=O)=O)C=C3)=NC=C2Br)C=CC=C1F)N
Biological Activity: TMX-2138 is a CDK PROTAC degrader, with IC50 values against different targets as follows: CDK1 (IC50 = 8.7 nM), CDK2 (IC50 = 10.9 nM), CDK5 (IC50 = 7.0 nM), CDK4 (IC50 = 901.0 nM), CDK6 (IC50 = 465.0 nM), CDK7 (IC50 = 286.0 nM), and CDK9 (IC50 = 25.7 nM). TMX-2138 promotes the ubiquitination of CDK and induces its degradation via the proteasomal pathway. TMX-2138 can be used in ovarian cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TMX-2138 | 98.99% | TMX-2138 is a CDK PROTAC degrader, with IC50 values against different targets as follows: CDK1 (IC50 = 8.7 nM), CDK2 (IC50 = 10.9 nM), CDK5 (IC50 = 7.0 nM), CDK4 (IC50 = 901.0 nM), CDK6 (IC50 = 465.0 nM), CDK7 (IC50 = 286.0 nM), and CDK9 (IC50 = 25.7 nM). TMX-2138 promotes the ubiquitination of CDK and induces its degradation via the proteasomal pathway. TMX-2138 can be used in ovarian cancer research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
