4264-93-1
Chemical Structure
Naphthol AS-TR phosphate disodium
- CAS No.: 4264-93-1
- Formula:C18H13ClNNa2O5P
- Molecular Weight:435.71
IUPAC Name: sodium 3-((4-chloro-2-methylphenyl)carbamoyl)naphthalen-2-yl phosphate
InChIKey: TYCHZTPSWMGRRI-UHFFFAOYSA-L
SMILES: O=C(C1=C(OP(O[Na])(O[Na])=O)C=C2C=CC=CC2=C1)NC3=CC=C(Cl)C=C3C
Biological Activity: Naphthol AS-TR Phosphate disodium is a water-soluble dye commonly used as an enzymatic substrate in various biochemical assays to detect alkaline phosphatase activity. Naphthol AS-TR Phosphate disodium has unique chemical properties that allow it to be hydrolyzed by alkaline phosphatase, forming a colored product that can be detected spectrophotometrically. This makes it a useful tool for monitoring enzyme activity in biological samples such as serum or urine.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Naphthol AS-TR phosphate disodium | 99.87% | Naphthol AS-TR Phosphate disodium is a water-soluble dye commonly used as an enzymatic substrate in various biochemical assays to detect alkaline phosphatase activity. Naphthol AS-TR Phosphate disodium has unique chemical properties that allow it to be hydrolyzed by alkaline phosphatase, forming a colored product that can be detected spectrophotometrically. This makes it a useful tool for monitoring enzyme activity in biological samples such as serum or urine. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
