62-23-7
62-23-7
Chemical Structure
4-Nitrobenzoic acid
- CAS No.: 62-23-7
- Formula:C7H5NO4
- Molecular Weight:167.12
IUPAC Name: 4-nitrobenzoic acid
InChIKey: OTLNPYWUJOZPPA-UHFFFAOYSA-N
SMILES: O=C(O)C1=CC=C([N+]([O-])=O)C=C1
Biological Activity: 4-Nitrobenzoic acid is a nitroaromatic compound that can be used in the synthesis of other active compounds. 4-Nitrobenzoic acid is also an inhibitor agent, which can be used for the recognition of the Mycobacterium tuberculosis complex and differentiation from non-tuberculous mycobacteria[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Nitrobenzoic acid | 99.84% | 4-Nitrobenzoic acid is a nitroaromatic compound that can be used in the synthesis of other active compounds. 4-Nitrobenzoic acid is also an inhibitor agent, which can be used for the recognition of the Mycobacterium tuberculosis complex and differentiation from non-tuberculous mycobacteria. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid (Standard) | ≥98% | 4-Nitrobenzoic acid (Standard) is the analytical standard of 4-Nitrobenzoic acid (HY-Y0607). This product is intended for research and analytical applications. 4-Nitrobenzoic acid is an oxidoreduction mediator and an electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from the reduced glucose oxidase and transfers them to the electrode to promote the glucose oxidation reaction, while minimizing the formation of protonated amine groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid-d2 | 99% | 4-Nitrobenzoic acid-d2 is the deuterium labeled 4-Nitrobenzoic acid (HY-Y0607). 4-Nitrobenzoic acid acts as a redox mediator and electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from reduced glucose oxidase and transfers them to the electrode to facilitate the glucose oxidation reaction, while minimizing the formation of protonated amino groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid-d4 | 4-Nitrobenzoic acid-d4 is the deuterium labeled 4-Nitrobenzoic acid (HY-Y0607). 4-Nitrobenzoic acid is an oxidoreduction mediator and an electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from the reduced glucose oxidase and transfers them to the electrode to promote the glucose oxidation reaction, while minimizing the formation of protonated amine groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-[(1E)-2-Nitroethenyl]benzoic acid | 4-[(1E)-2-Nitroethenyl]benzoic acid is an E3 ligase ligand. 4-[(1E)-2-Nitroethenyl]benzoic acid can be used for synthesis of PROTAC BRD4 Degrader-38 (HY-175240). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ethyl 4-nitrobenzoate | 99.91% | Ethyl 4-nitrobenzoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrocinnamic acid (Standard) | ≥98% | 4-Nitrocinnamic acid (Standard) is the analytical standard of 4-Nitrocinnamic acid (HY-W015069). This product is intended for research and analytical applications. 4-Nitrocinnamic acid is a Phenylpropanoids product that can be isolated from the heartwoods of Cassia garrettiana. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Hydroxy-5-nitrobenzoic acid, 99% (Standard) | ≥98% | 2-Hydroxy-5-nitrobenzoic acid, 99% (Anilotic acid, 99%) Standard is the analytical standard of 2-Hydroxy-5-nitrobenzoic acid, 99% (HY-W016352 ). This product is intended for research and analytical applications. 2-Hydroxy-5-nitrobenzoic acid, 99% (Anilotic acid, 99%) is a basic chemical raw material and organic synthesis intermediate that can be used to synthesize Mesalamine (HY-15027). 2-Hydroxy-5-nitrobenzoic acid, 99% is a matrix for ultraviolet matrix-assisted laser desorption/ionization (UV-MALDI) mass spectrometry. 2-Hydroxy-5-nitrobenzoic acid, 99% can also serve as an HPLC analytical standard, pH indicator, and heavy metal detection agent. 2-Hydroxy-5-nitrobenzoic acid, 99% can also be used to study the oxidation of phenolic compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Methyl-3-nitrobenzoic acid | 99.96% | 4-Methyl-3-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4'-Nitroacetophenone | 99.69% | 4'-Nitroacetophenone is a nitroaromatic compound. 4'-Nitroacetophenone is an important organic synthetic intermediate, which can be used for the synthesis of other active compounds such as Chloramphenicol (HY-B0239). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Nitrobenzoic acid | 99.96% | 2-Nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Chloro-5-nitrobenzoic acid (Standard) | ≥98% | 2-Chloro-5-nitrobenzoic acid (Standard) is the analytical standard of 2-Chloro-5-nitrobenzoic acid. This product is intended for research and analytical applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Nitrobenzoic acid | 99.91% | 3-Nitrobenzoic acid (m-Carboxynitrobenzene; m-Nitrobenzenecarboxylic acid; m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi. 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Amino-5-nitrobenzoic acid | 99.50% | 2-Amino-5-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
