4546-72-9
4546-72-9
Chemical Structure
Bz-dA
Synonym(s): N6-Benzoyl-2'-deoxyadenosine
- No. CAS: 4546-72-9
- Formula:C17H17N5O4
- Molecular Weight:355.35
IUPAC Name: N6-Benzoyl-2'-deoxyadenosine
InChIKey: PIXHJAPVPCVZSV-YNEHKIRRSA-N
SMILES: O[C@H]1C[C@H](N2C(N=CN=C3NC(C4=CC=CC=C4)=O)=C3N=C2)O[C@@H]1CO
Biological Activity: Bz-dA (N6-Benzoyl-2'-deoxyadenosine) is a nucleoside analog that can be used to synthesize oligoribonucleotides[1]
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Bz-dA | 98.43% | Bz-dA (N6-Benzoyl-2'-deoxyadenosine) is a nucleoside analog that can be used to synthesize oligoribonucleotides | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-O-TBDMS-Bz-dA | 98.37% | 5'-O-TBDMS-Bz-dA is a nucleoside with protective and modification effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N6-Benzoyl-3'-fluoro-2',3'-dideoxyadenosine | N6-Benzoyl-3'-fluoro-2',3'-dideoxyadenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N6-Benzoyl-2’-chloro-2’-deoxyadenosine | N6-Benzoyl-2’-chloro-2’-deoxyadenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Benzoyl-3′-O-methyladenosine | N-Benzoyl-3′-O-methyladenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N6-Benzoyl-9-β-D-arabinofuranosyladenine | 98.17% | N6-Benzoyl-9-β-D-arabinofuranosyladenine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bz-rA | 99.51% | Bz-rA (N6-Benzoyladenosine) is a nucleoside derivative with an N6 protecting group. Bz-rA is mainly used as a synthetic intermediate to participate in photocatalytic oxidative cyclization reactions and synthesize oligoribonucleotides. Bz-rA can be used to efficiently construct heterocyclic skeletons in photochemical conversions and protect the ribose moiety to regulate the cyclization pathway. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N6-Benzoyl-2'-fluoro-2'-deoxyarabinoadenosine | N6-Benzoyl-2'-fluoro-2'-deoxyarabinoadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-F-Bz-A | 99.60% | 2'-F-Bz-A (N6-Benzoyl-2'-Fluoro-2'-deoxyadenosine) is a nucleoside analog that can be used to synthesize oligoribonucleotides. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N6-Benzoyl-2'-deoxyadenosine monohydrate | 98.0% | N6-Benzoyl-2'-deoxyadenosine monohydrate is a nucleoside analog that is used in the diagnosis of infections caused by bacteria by binding to DNA duplexes and altering their structure, which can be detected using electrophoresis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxy-N6-phenoxyacetyladenosine | 2'-Deoxy-N6-phenoxyacetyladenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
