498-45-3
498-45-3
Chemical Structure
Scopine
Synonym(s): 6,7-Epoxytropine
- CAS No.: 498-45-3
- Formula:C8H13NO2
- Molecular Weight:155.19
IUPAC Name: (1R,2R,4S,5S,7s)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol
InChIKey: FIMXSEMBHGTNKT-RZVDLVGDSA-N
SMILES: [H][C@@]12[C@]3([H])[C@@]([H])(O3)[C@@](C[C@H](O)C2)([H])N1C
Biological Activity: Scopine is a metabolite of Scopolamine (HY-N0296) and brain-targeting compound. Scopine significantly increases the brain exposure of Chlorambucil (HY-13593) and enhances its anti-glioma activity. Scopine can be used in targeted therapy research for brain gliomas[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Scopine | 98.0% | Scopine is a metabolite of Scopolamine (HY-N0296) and brain-targeting compound. Scopine significantly increases the brain exposure of Chlorambucil (HY-13593) and enhances its anti-glioma activity. Scopine can be used in targeted therapy research for brain gliomas. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Conduritol B epoxide | 99.92% | Conduritol B epoxide is an irreversible covalently bound acid β-glucosidase (GCase) inhibitor. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Lentiginosine | (-)-Lentiginosine is a compound that can be obtained by a specific synthetic method. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Erycibelline | Erycibelline is a naturally occurring dihydroxynortropane alkaloid. Erycibelline can be isolated from the Chinese herb medicine Erycibe elliptilimba Merr. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Scopoline | 98.0% | Scopoline (compound 3a) is a compound formed from Scopine (HY-B0459), an α1 adrenergic receptor agonist. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Scopine hydrochloride | 99.69% | Scopine hydrochloride is a metabolite of Scopolamine (HY-N0296) and brain-targeting compound. Scopine hydrochloride significantly increases the brain exposure of Chlorambucil (HY-13593) and enhances its anti-glioma activity. Scopine hydrochloride can be used in targeted therapy research for brain gliomas. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tropine | 99.99% | Tropine is a tropane alkaloid. Tropine serves as an important intermediate for the synthesis of anticholinergics and bronchodilators such as Atropine (HY-B1205) and Scopolamine (HY-N0296). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-Hydroxytropinone (Standard) | ≥98% | 6-Hydroxytropinone (Standard) is the analytical standard of 6-Hydroxytropinone. This product is intended for research and analytical applications. 6-Hydroxytropinone is a cyclic hydroxylation product of Tropinone (HY-Y0135), and serves as an indicator for tropane alkaloid metabolism in plants or microorganisms. 6-Hydroxytropinone itself has no significant anticholinergic toxicity, nor does it act as a substrate for Tropine (HY-N7061) dehydrogenase. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nortropine | 99.91% | Nortropine (Nortropenol), isolated from the total alkaloids of Convolvulus subhirsutus, is an intermediate in tropine breakdown and reactions leading to succinate. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pseudotropine | 98.46% | Pseudotropine (β-Tropine), a derivative of Tropane, is a plant alkaloid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nortropine hydrochloride | 99.65% | Nortropine hydrochloride can be isolated from the Convolvulus subhirsutus alkaloid and is an intermediate in the decomposition and reaction of tropine to produce succinic acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
